5-Bromo-2-chlorobenzaldehyde - CAS 189628-37-3
Catalog: |
BB014645 |
Product Name: |
5-Bromo-2-chlorobenzaldehyde |
CAS: |
189628-37-3 |
Synonyms: |
5-bromo-2-chlorobenzaldehyde; 5-bromo-2-chlorobenzaldehyde |
IUPAC Name: | 5-bromo-2-chlorobenzaldehyde |
Description: | 5-Bromo-2-chlorobenzaldehyde (CAS# 189628-37-3) is a useful synthesis intermediate. |
Molecular Weight: | 219.46 |
Molecular Formula: | C7H4BrClO |
Canonical SMILES: | C1=CC(=C(C=C1Br)C=O)Cl |
InChI: | InChI=1S/C7H4BrClO/c8-6-1-2-7(9)5(3-6)4-10/h1-4H |
InChI Key: | DPKKRQAEYWOISP-UHFFFAOYSA-N |
Boiling Point: | 261 ℃ at 760 mmHg |
Density: | 1.698 g/cm3 |
MDL: | MFCD08445659 |
LogP: | 2.91500 |
GHS Hazard Statement: | H302 (50%): Harmful if swallowed [Warning Acute toxicity, oral] |
Precautionary Statement: | P261, P264, P270, P271, P280, P301+P312, P302+P352, P304+P340, P305+P351+P338, P312, P321, P330, P332+P313, P337+P313, P362, P403+P233, P405, and P501 |
Signal Word: | Warning |
Publication Number | Title | Priority Date |
CN-111925289-A | Preparation method of 5-bromo-2-chlorobenzoic acid | 20200630 |
US-2020392113-A1 | Substituted pyrazolo-pyrazines and their use as glun2b receptor modulators | 20190614 |
WO-2020249785-A1 | Substituted heteroaromatic pyrazolo-pyridines and their use as glun2b receptor modulators | 20190614 |
WO-2020249792-A1 | Substituted pyrazolo-pyridine amides and their use as glun2b receptor modulators | 20190614 |
WO-2020249802-A1 | Substituted pyrazolo-pyrazines and their use as glun2b receptor modulators | 20190614 |
Complexity: | 129 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 217.91341 |
Formal Charge: | 0 |
Heavy Atom Count: | 10 |
Hydrogen Bond Acceptor Count: | 1 |
Hydrogen Bond Donor Count: | 0 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 217.91341 |
Rotatable Bond Count: | 1 |
Topological Polar Surface Area: | 17.1 Å2 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 2.7 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Carbonyl Compounds
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS