5-Bromo-2-(bromomethyl)benzonitrile - CAS 156001-53-5
Catalog: |
BB011192 |
Product Name: |
5-Bromo-2-(bromomethyl)benzonitrile |
CAS: |
156001-53-5 |
Synonyms: |
5-bromo-2-(bromomethyl)benzonitrile; 5-bromo-2-(bromomethyl)benzonitrile |
IUPAC Name: | 5-bromo-2-(bromomethyl)benzonitrile |
Description: | 5-Bromo-2-(bromomethyl)benzonitrile (CAS# 156001-53-5) is a useful research chemical. |
Molecular Weight: | 274.94 |
Molecular Formula: | C8H5Br2N |
Canonical SMILES: | C1=CC(=C(C=C1Br)C#N)CBr |
InChI: | InChI=1S/C8H5Br2N/c9-4-6-1-2-8(10)3-7(6)5-11/h1-3H,4H2 |
InChI Key: | RPQAJIVYLBTILC-UHFFFAOYSA-N |
LogP: | 3.21568 |
GHS Hazard Statement: | H302 (100%): Harmful if swallowed [Warning Acute toxicity, oral] |
Precautionary Statement: | P260, P264, P270, P280, P301+P312, P301+P330+P331, P303+P361+P353, P304+P340, P305+P351+P338, P310, P321, P330, P363, P405, and P501 |
Signal Word: | Danger |
Publication Number | Title | Priority Date |
WO-2021157684-A1 | Sulfonamide or sulfinamide compound having effect of inducing brd4 protein degradation and pharmaceutical use thereof | 20200206 |
WO-2021067606-A1 | Brm targeting compounds and associated methods of use | 20191001 |
WO-2020247475-A1 | Imidazo[1,2-c]pyrimidine derivatives as prc2 inhibitors for treating cancer | 20190605 |
WO-2020219448-A1 | Naphthyridine derivatives as prc2 inhibitors | 20190422 |
TW-202045491-A | Azole derivatives | 20190220 |
Complexity: | 172 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 274.87682 |
Formal Charge: | 0 |
Heavy Atom Count: | 11 |
Hydrogen Bond Acceptor Count: | 1 |
Hydrogen Bond Donor Count: | 0 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 272.87887 |
Rotatable Bond Count: | 1 |
Topological Polar Surface Area: | 23.8 Å2 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 2.9 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Nitrogen Compounds
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS