5-Bromo-2,3-dihydro-1H-inden-1-one Oxime - CAS 185122-63-8
Catalog: |
BB014195 |
Product Name: |
5-Bromo-2,3-dihydro-1H-inden-1-one Oxime |
CAS: |
185122-63-8 |
Synonyms: |
5-bromo-2,3-dihydroinden-1-one oxime; N-(5-bromo-2,3-dihydroinden-1-ylidene)hydroxylamine |
IUPAC Name: | (NZ)-N-(5-bromo-2,3-dihydroinden-1-ylidene)hydroxylamine |
Description: | 5-Bromo-2,3-dihydro-1H-inden-1-one Oxime (CAS# 185122-63-8 ) is a useful research chemical. |
Molecular Weight: | 226.07 |
Molecular Formula: | C9H8BrNO |
Canonical SMILES: | C1CC(=NO)C2=C1C=C(C=C2)Br |
InChI: | InChI=1S/C9H8BrNO/c10-7-2-3-8-6(5-7)1-4-9(8)11-12/h2-3,5,12H,1,4H2 |
InChI Key: | FKVWLYRRDKFLBM-UHFFFAOYSA-N |
LogP: | 2.57360 |
Publication Number | Title | Priority Date |
US-2018002346-A1 | Azolobenzazine compounds, compositions comprising these compounds and their use for controlling invertebrate pests | 20150114 |
US-2017137385-A1 | Isoquinoline compounds, a process for their preparation, and pharmaceutical compositions containing them | 20140221 |
US-9809553-B2 | Isoquinoline compounds, a process for their preparation, and pharmaceutical compositions containing them | 20140221 |
US-2016157491-A1 | Pesticide Compounds | 20130715 |
US-9497970-B2 | Pesticide compounds | 20130715 |
Complexity: | 205 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 1 |
Exact Mass: | 224.97893 |
Formal Charge: | 0 |
Heavy Atom Count: | 12 |
Hydrogen Bond Acceptor Count: | 2 |
Hydrogen Bond Donor Count: | 1 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 224.97893 |
Rotatable Bond Count: | 0 |
Topological Polar Surface Area: | 32.6 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 2.6 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Halides
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS