5-Bromo-1H-pyrazolo[4,3-b]pyridine - CAS 1227628-78-5
Catalog: |
BB005514 |
Product Name: |
5-Bromo-1H-pyrazolo[4,3-b]pyridine |
CAS: |
1227628-78-5 |
Synonyms: |
5-bromo-1H-pyrazolo[4,3-b]pyridine |
IUPAC Name: | 5-bromo-1H-pyrazolo[4,3-b]pyridine |
Description: | 5-Bromo-1H-pyrazolo[4,3-b]pyridine (CAS# 1227628-78-5) is a useful research chemical. |
Molecular Weight: | 198.02 |
Molecular Formula: | C6H4BrN3 |
Canonical SMILES: | C1=CC(=NC2=C1NN=C2)Br |
InChI: | InChI=1S/C6H4BrN3/c7-6-2-1-4-5(9-6)3-8-10-4/h1-3H,(H,8,10) |
InChI Key: | QWLXNBNVCRSNEX-UHFFFAOYSA-N |
Purity: | 97.0 % |
Appearance: | Solid |
LogP: | 1.72040 |
GHS Hazard Statement: | H302 (100%): Harmful if swallowed [Warning Acute toxicity, oral] |
Precautionary Statement: | P261, P264, P270, P271, P280, P301+P312, P302+P352, P304+P340, P305+P351+P338, P312, P321, P330, P332+P313, P337+P313, P362, P403+P233, P405, and P501 |
Signal Word: | Warning |
Publication Number | Title | Priority Date |
CN-110498798-B | Microreactor series connection synthesis method of indole anticancer drug molecules | 20190828 |
WO-2019149738-A1 | Protein kinase mkk4 inhibitors for promoting liver regeneration or reducing or preventing hepatocyte death | 20180131 |
AU-2019216264-A1 | Protein kinase MKK4 inhibitors for promoting liver regeneration or reducing or preventing hepatocyte death | 20180131 |
CN-111788195-A | Protein kinase MKK4 inhibitors for promoting liver regeneration or reducing or preventing hepatocyte death | 20180131 |
EP-3746437-A1 | Protein kinase mkk4 inhibitors for promoting liver regeneration or reducing or preventing hepatocyte death | 20180131 |
Complexity: | 130 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 196.95886 |
Formal Charge: | 0 |
Heavy Atom Count: | 10 |
Hydrogen Bond Acceptor Count: | 2 |
Hydrogen Bond Donor Count: | 1 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 196.95886 |
Rotatable Bond Count: | 0 |
Topological Polar Surface Area: | 41.6 Å2 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 1.6 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Pyridines
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS