5-(Benzyloxy)salicylaldehyde - CAS 56979-56-7
Catalog: |
BB029556 |
Product Name: |
5-(Benzyloxy)salicylaldehyde |
CAS: |
56979-56-7 |
Synonyms: |
2-hydroxy-5-phenylmethoxybenzaldehyde; 2-hydroxy-5-phenylmethoxybenzaldehyde |
IUPAC Name: | 2-hydroxy-5-phenylmethoxybenzaldehyde |
Description: | 5-(Benzyloxy)salicylaldehyde (CAS# 56979-56-7) is a useful research chemical. |
Molecular Weight: | 228.24 |
Molecular Formula: | C14H12O3 |
Canonical SMILES: | C1=CC=C(C=C1)COC2=CC(=C(C=C2)O)C=O |
InChI: | InChI=1S/C14H12O3/c15-9-12-8-13(6-7-14(12)16)17-10-11-4-2-1-3-5-11/h1-9,16H,10H2 |
InChI Key: | QIQZAISWDRNIFG-UHFFFAOYSA-N |
LogP: | 2.78370 |
Publication Number | Title | Priority Date |
EP-3337476-A1 | Compounds and methods for the targeted degradation of bromodomain-containing proteins | 20150819 |
US-2017065719-A1 | Compounds and methods for the targeted degradation of bromodomain-containing proteins | 20150819 |
WO-2017030814-A1 | Compounds and methods for the targeted degradation of bromodomain-containing proteins | 20150819 |
US-10772962-B2 | Compounds and methods for the targeted degradation of bromodomain-containing proteins | 20150819 |
US-2021187108-A1 | Compounds and methods for the targeted degradation of bromodomain-containing proteins | 20150819 |
Complexity: | 236 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 228.078644241 |
Formal Charge: | 0 |
Heavy Atom Count: | 17 |
Hydrogen Bond Acceptor Count: | 3 |
Hydrogen Bond Donor Count: | 1 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 228.078644241 |
Rotatable Bond Count: | 4 |
Topological Polar Surface Area: | 46.5 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 3 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Carbonyl Compounds
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS