5-Aminopyridine-3-boronic Acid - CAS 1169748-84-8
Catalog: |
BB003826 |
Product Name: |
5-Aminopyridine-3-boronic Acid |
CAS: |
1169748-84-8 |
Synonyms: |
(5-amino-3-pyridinyl)boronic acid; (5-aminopyridin-3-yl)boronic acid |
IUPAC Name: | (5-aminopyridin-3-yl)boronic acid |
Description: | 5-Aminopyridine-3-boronic Acid (CAS# 1169748-84-8) is a reagent used in the development of potent coagulation factor IXa (FIXa) inhibitors. |
Molecular Weight: | 137.93 |
Molecular Formula: | C5H7N2O2B |
Canonical SMILES: | B(C1=CC(=CN=C1)N)(O)O |
InChI: | InChI=1S/C5H7BN2O2/c7-5-1-4(6(9)10)2-8-3-5/h1-3,9-10H,7H2 |
InChI Key: | RKZHYRRFTYDWTH-UHFFFAOYSA-N |
Appearance: | Solid |
MDL: | MFCD07374883 |
LogP: | -1.07520 |
Publication Number | Title | Priority Date |
WO-2020242245-A1 | Phthalazinone compounds and use thereof | 20190529 |
EP-3523292-A1 | Heteroaryl compounds and their use as mer inhibitors | 20161010 |
US-2019315716-A1 | Heteroaryl compounds and their use as mer inhibitors | 20161010 |
WO-2018071343-A1 | Heteroaryl compounds and their use as mer inhibitors | 20161010 |
US-10913730-B2 | Heteroaryl compounds and their use as Mer inhibitors | 20161010 |
Complexity: | 112 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 138.0600576 |
Formal Charge: | 0 |
Heavy Atom Count: | 10 |
Hydrogen Bond Acceptor Count: | 4 |
Hydrogen Bond Donor Count: | 3 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 138.0600576 |
Rotatable Bond Count: | 1 |
Topological Polar Surface Area: | 79.4 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Boronic Acids and Esters
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS