5-(Aminomethyl)thiophene-2-sulfonamide - CAS 408352-66-9
Catalog: |
BB061395 |
Product Name: |
5-(Aminomethyl)thiophene-2-sulfonamide |
CAS: |
408352-66-9 |
Synonyms: |
5-(Aminomethyl)-2-thiophenesulfonamide; 5-(Aminomethyl)thiophene-2-sulfonamide |
IUPAC Name: | 5-(aminomethyl)thiophene-2-sulfonamide |
Description: | 5-(Aminomethyl)thiophene-2-sulfonamide |
Molecular Weight: | 192.26 |
Molecular Formula: | C5H8N2O2S2 |
Canonical SMILES: | C1=C(SC(=C1)S(=O)(=O)N)CN |
InChI: | InChI=1S/C5H8N2O2S2/c6-3-4-1-2-5(10-4)11(7,8)9/h1-2H,3,6H2,(H2,7,8,9) |
InChI Key: | BAFJJOAPLFRFQZ-UHFFFAOYSA-N |
GHS Hazard Statement: | H302 (100%): Harmful if swallowed [Warning Acute toxicity, oral] |
Precautionary Statement: | P264, P270, P273, P301+P317, P330, P391, and P501 |
Signal Word: | Warning |
Publication Number | Title | Priority Date |
WO-2021133915-A1 | Ectonucleotide pyrophosphatase/phosphodiesterase 1 (enpp1) modulators and uses thereof | 20191223 |
US-2021154334-A1 | Dual-targeted carbonic anhydrase ix complex and contrast agent thereof | 20191122 |
US-2008207607-A1 | Heterotricyclic metalloprotease inhibitors | 20061120 |
US-2008221083-A1 | Heterobicyclic metalloprotease inhibitors | 20061120 |
US-2010087420-A1 | Heterotricyclic Metalloprotease Inhibitors | 20061120 |
US-2010249102-A1 | Heterotricyclic Metalloprotease Inhibitors | 20061120 |
US-7749996-B2 | Heterotricyclic metalloprotease inhibitors | 20061120 |
US-2007155738-A1 | Heterobicyclic metalloprotease inhibitors | 20050520 |
US-2008161300-A1 | Heterobicyclic metalloprotease inhibitors | 20050520 |
US-2009137547-A1 | Heterobicyclic metalloprotease inhibitors | 20050520 |
Complexity: | 221 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 192.00271985 |
Formal Charge: | 0 |
Heavy Atom Count: | 11 |
Hydrogen Bond Acceptor Count: | 5 |
Hydrogen Bond Donor Count: | 2 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 192.00271985 |
Rotatable Bond Count: | 2 |
Topological Polar Surface Area: | 123Ų |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | -0.6 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Other Building Blocks
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS