5-(Aminomethyl)-2-morpholinopyridine - CAS 771572-26-0
Catalog: |
BB035825 |
Product Name: |
5-(Aminomethyl)-2-morpholinopyridine |
CAS: |
771572-26-0 |
Synonyms: |
[6-(4-morpholinyl)-3-pyridinyl]methanamine; (6-morpholin-4-ylpyridin-3-yl)methanamine |
IUPAC Name: | (6-morpholin-4-ylpyridin-3-yl)methanamine |
Description: | 5-(Aminomethyl)-2-morpholinopyridine (CAS# 771572-26-0) is a useful research chemical. |
Molecular Weight: | 193.25 |
Molecular Formula: | C10H15N3O |
Canonical SMILES: | C1COCCN1C2=NC=C(C=C2)CN |
InChI: | InChI=1S/C10H15N3O/c11-7-9-1-2-10(12-8-9)13-3-5-14-6-4-13/h1-2,8H,3-7,11H2 |
InChI Key: | QXGZUDFSJASRPB-UHFFFAOYSA-N |
MDL: | MFCD06213528 |
LogP: | 1.14220 |
GHS Hazard Statement: | H302 (100%): Harmful if swallowed [Warning Acute toxicity, oral] |
Precautionary Statement: | P261, P264, P270, P271, P280, P301+P312, P302+P352, P304+P340, P305+P351+P338, P310, P312, P321, P330, P332+P313, P362, P403+P233, P405, and P501 |
Signal Word: | Danger |
Publication Number | Title | Priority Date |
EP-1757591-A1 | Cinnamide compound | 20040526 |
EP-2261218-A2 | Process for preparing phenyl-, pyridinyl- or pyrimidinyl-substituted imidazoles | 20040526 |
US-2006004013-A1 | Cinnamide compound | 20040526 |
US-2008070902-A1 | Cinnamide Compound | 20040526 |
US-2009281310-A1 | Cinnamide compound | 20040526 |
Complexity: | 171 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 193.121512110 |
Formal Charge: | 0 |
Heavy Atom Count: | 14 |
Hydrogen Bond Acceptor Count: | 4 |
Hydrogen Bond Donor Count: | 1 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 193.121512110 |
Rotatable Bond Count: | 2 |
Topological Polar Surface Area: | 51.4 Å2 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | -0.2 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Amines and Anilines
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS