5-Aminobenzo[c]isothiazole - CAS 51253-66-8
Catalog: |
BB027382 |
Product Name: |
5-Aminobenzo[c]isothiazole |
CAS: |
51253-66-8 |
Synonyms: |
2,1-benzothiazol-5-amine; 2,1-benzothiazol-5-amine |
IUPAC Name: | 2,1-benzothiazol-5-amine |
Description: | 5-Aminobenzo[c]isothiazole (CAS# 51253-66-8) is a useful research chemical. |
Molecular Weight: | 150.20 |
Molecular Formula: | C7H6N2S |
Canonical SMILES: | C1=CC2=NSC=C2C=C1N |
InChI: | InChI=1S/C7H6N2S/c8-6-1-2-7-5(3-6)4-10-9-7/h1-4H,8H2 |
InChI Key: | CFHZGJYPGQCCJN-UHFFFAOYSA-N |
LogP: | 2.45970 |
Publication Number | Title | Priority Date |
EP-3087072-A2 | Spiroindoline antiparasitic derivatives | 20131224 |
WO-2015100232-A2 | Spiroindoline antiparasitic derivatives | 20131224 |
CN-104781251-A | Bicyclic heterocycle substituted pyridyl compounds useful as kinase modulators | 20121108 |
CN-104781251-B | Can as kinase modulator through the substituted pyridinyl compounds of bicyclic heterocycle | 20121108 |
EP-2922840-A1 | Bicyclic heterocycle substituted pyridyl compounds useful as kinase modulators | 20121108 |
Complexity: | 129 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 150.02516937 |
Formal Charge: | 0 |
Heavy Atom Count: | 10 |
Hydrogen Bond Acceptor Count: | 3 |
Hydrogen Bond Donor Count: | 1 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 150.02516937 |
Rotatable Bond Count: | 0 |
Topological Polar Surface Area: | 67.2 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 1.6 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Amines and Anilines
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS