5-Amino-8-methoxyquinoline - CAS 70945-35-6
Catalog: |
BB034271 |
Product Name: |
5-Amino-8-methoxyquinoline |
CAS: |
70945-35-6 |
Synonyms: |
8-methoxy-5-quinolinamine; 8-methoxyquinolin-5-amine |
IUPAC Name: | 8-methoxyquinolin-5-amine |
Description: | 5-Amino-8-methoxyquinoline (CAS# 70945-35-6) is a useful research chemical. |
Molecular Weight: | 174.20 |
Molecular Formula: | C10H10N2O |
Canonical SMILES: | COC1=C2C(=C(C=C1)N)C=CC=N2 |
InChI: | InChI=1S/C10H10N2O/c1-13-9-5-4-8(11)7-3-2-6-12-10(7)9/h2-6H,11H2,1H3 |
InChI Key: | PFWACEYBFBFSRM-UHFFFAOYSA-N |
MDL: | MFCD09044356 |
LogP: | 2.40680 |
GHS Hazard Statement: | H302 (100%): Harmful if swallowed [Warning Acute toxicity, oral] |
Precautionary Statement: | P261, P264, P270, P271, P280, P301+P312, P302+P352, P304+P340, P305+P351+P338, P312, P321, P330, P332+P313, P337+P313, P362, P403+P233, P405, and P501 |
Signal Word: | Warning |
Publication Number | Title | Priority Date |
US-2012157465-A1 | Dna methylation inhibitors | 20101220 |
US-8546397-B2 | DNA methylation inhibitors | 20101220 |
WO-2012087889-A2 | Dna methylation inhibitors | 20101220 |
CA-1340821-C | Heterocyclic compounds and anticancer-drug reinforcing agents containing them as effective components | 19881006 |
EP-0363212-A2 | Novel heterocyclic compounds and anticancer-drug reinforcing agents containing them as effective components | 19881006 |
Complexity: | 174 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 174.079312947 |
Formal Charge: | 0 |
Heavy Atom Count: | 13 |
Hydrogen Bond Acceptor Count: | 3 |
Hydrogen Bond Donor Count: | 1 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 174.079312947 |
Rotatable Bond Count: | 1 |
Topological Polar Surface Area: | 48.1 Å2 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 1.7 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Amines and Anilines
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS