5-Amino-3-chloroisoquinoline - CAS 58142-49-7
Catalog: |
BB029950 |
Product Name: |
5-Amino-3-chloroisoquinoline |
CAS: |
58142-49-7 |
Synonyms: |
3-chloro-5-isoquinolinamine; 3-chloroisoquinolin-5-amine |
IUPAC Name: | 3-chloroisoquinolin-5-amine |
Description: | 5-Amino-3-chloroisoquinoline (CAS# 58142-49-7) is a useful research chemical. |
Molecular Weight: | 178.62 |
Molecular Formula: | C9H7ClN2 |
Canonical SMILES: | C1=CC2=CN=C(C=C2C(=C1)N)Cl |
InChI: | InChI=1S/C9H7ClN2/c10-9-4-7-6(5-12-9)2-1-3-8(7)11/h1-5H,11H2 |
InChI Key: | ZITUQCQEDBPHMJ-UHFFFAOYSA-N |
Boiling Point: | 372.583 °C at 760 mmHg |
Density: | 1.363 g/cm3 |
MDL: | MFCD09999240 |
LogP: | 3.05160 |
Publication Number | Title | Priority Date |
WO-2021011913-A1 | Tau-protein targeting compounds and associated methods of use | 20190717 |
AU-2016340798-A1 | Aminoisoxazoline compounds as agonists of alpha7-nicotinic acetylcholine receptors | 20151020 |
CA-3002801-A1 | Aminoisoxazoline compounds as agonists of alpha7-nicotinic acetylcholine receptors | 20151020 |
EP-3365061-A1 | Aminoisoxazoline compounds as agonists of alpha7-nicotinic acetylcholine receptors | 20151020 |
JP-2018531262-A | Aminoisoxazoline compounds as agonists of α7-nicotinic acetylcholine receptors | 20151020 |
Complexity: | 163 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 178.0297759 |
Formal Charge: | 0 |
Heavy Atom Count: | 12 |
Hydrogen Bond Acceptor Count: | 2 |
Hydrogen Bond Donor Count: | 1 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 178.0297759 |
Rotatable Bond Count: | 0 |
Topological Polar Surface Area: | 38.9 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 2.4 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Amines and Anilines
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS