5-Amino-3-(4-bromophenyl)isoxazole - CAS 119162-53-7
Catalog: |
BB004423 |
Product Name: |
5-Amino-3-(4-bromophenyl)isoxazole |
CAS: |
119162-53-7 |
Synonyms: |
3-(4-bromophenyl)-5-isoxazolamine; 3-(4-bromophenyl)-1,2-oxazol-5-amine |
IUPAC Name: | 3-(4-bromophenyl)-1,2-oxazol-5-amine |
Description: | 5-Amino-3-(4-bromophenyl)isoxazole (CAS# 119162-53-7) is a useful research chemical for organic synthesis and other chemical processes. |
Molecular Weight: | 239.07 |
Molecular Formula: | C9H7BrN2O |
Canonical SMILES: | C1=CC(=CC=C1C2=NOC(=C2)N)Br |
InChI: | InChI=1S/C9H7BrN2O/c10-7-3-1-6(2-4-7)8-5-9(11)13-12-8/h1-5H,11H2 |
InChI Key: | RKWRDXQHQYRFCX-UHFFFAOYSA-N |
MDL: | MFCD06199354 |
LogP: | 3.26750 |
GHS Hazard Statement: | H302 (100%): Harmful if swallowed [Warning Acute toxicity, oral] |
Precautionary Statement: | P261, P264, P270, P271, P280, P301+P312, P302+P352, P304+P340, P305+P351+P338, P312, P321, P330, P332+P313, P337+P313, P362, P403+P233, P405, and P501 |
Signal Word: | Warning |
Publication Number | Title | Priority Date |
WO-2020227168-A1 | Inhibiting trabid | 20190503 |
CN-107628979-B | Method for synthesizing 2H-azacyclo acrylamide | 20171027 |
CA-2782588-A1 | Nitrogen-containing heteroaryl derivatives | 20100122 |
EP-2526098-A1 | Nitrogen-containing heteroaryl derivatives | 20100122 |
EP-2526098-B1 | Nitrogen-containing heteroaryl derivatives | 20100122 |
Complexity: | 171 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 237.97418 |
Formal Charge: | 0 |
Heavy Atom Count: | 13 |
Hydrogen Bond Acceptor Count: | 3 |
Hydrogen Bond Donor Count: | 1 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 237.97418 |
Rotatable Bond Count: | 1 |
Topological Polar Surface Area: | 52 Å2 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 2.4 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Amines and Anilines
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS