5-Amino-2-hydroxypyridine - CAS 33630-94-3
Catalog: |
BB021799 |
Product Name: |
5-Amino-2-hydroxypyridine |
CAS: |
33630-94-3 |
Synonyms: |
5-amino-1H-pyridin-2-one; 5-amino-1H-pyridin-2-one |
IUPAC Name: | 5-amino-1H-pyridin-2-one |
Description: | 5-Amino-2-hydroxypyridine (CAS# 33630-94-3) is a useful research chemical for organic synthesis and other chemical processes. |
Molecular Weight: | 110.11 |
Molecular Formula: | C5H6N2O |
Canonical SMILES: | C1=CC(=O)NC=C1N |
InChI: | InChI=1S/C5H6N2O/c6-4-1-2-5(8)7-3-4/h1-3H,6H2,(H,7,8) |
InChI Key: | GDOIKKMNCIMDAO-UHFFFAOYSA-N |
Boiling Point: | 211 °C at 760 mmHg |
Density: | 1.208 g/cm3 |
Appearance: | Dark brown powder |
MDL: | MFCD03427652 |
LogP: | 0.95060 |
GHS Hazard Statement: | H302 (28.57%): Harmful if swallowed [Warning Acute toxicity, oral] |
Precautionary Statement: | P261, P264, P270, P271, P280, P301+P312, P302+P352, P304+P340, P305+P351+P338, P312, P321, P330, P332+P313, P337+P313, P362, P403+P233, P405, and P501 |
Signal Word: | Warning |
Publication Number | Title | Priority Date |
CN-113512002-A | Pyrazole amide compound containing azo structure and preparation and application thereof | 20200410 |
WO-2021164746-A1 | Substituted aryl compound | 20200219 |
CN-110330479-A | A kind of antitumoral compounds and application thereof as AXL inhibitor | 20190719 |
WO-2021012717-A1 | Antitumor compound used as axl inhibitor and use thereof | 20190719 |
US-2020171020-A1 | Substituted 6-azabenzimidazole compounds | 20181031 |
Complexity: | 169 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 110.048012819 |
Formal Charge: | 0 |
Heavy Atom Count: | 8 |
Hydrogen Bond Acceptor Count: | 2 |
Hydrogen Bond Donor Count: | 2 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 110.048012819 |
Rotatable Bond Count: | 0 |
Topological Polar Surface Area: | 55.1 Å2 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | -0.8 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Alcohols and Derivatives
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS