5-Amino-2-ethoxybenzonitrile - CAS 1020046-39-2
Catalog: |
BB000734 |
Product Name: |
5-Amino-2-ethoxybenzonitrile |
CAS: |
1020046-39-2 |
Synonyms: |
5-amino-2-ethoxybenzonitrile |
IUPAC Name: | 5-amino-2-ethoxybenzonitrile |
Description: | 5-Amino-2-ethoxybenzonitrile (CAS# 1020046-39-2) is a useful research chemical. |
Molecular Weight: | 162.19 |
Molecular Formula: | C9H10N2O |
Canonical SMILES: | CCOC1=C(C=C(C=C1)N)C#N |
InChI: | InChI=1S/C9H10N2O/c1-2-12-9-4-3-8(11)5-7(9)6-10/h3-5H,2,11H2,1H3 |
InChI Key: | RIPHVNUYRKOROW-UHFFFAOYSA-N |
Purity: | 95 % |
MDL: | MFCD10686562 |
LogP: | 2.12038 |
Publication Number | Title | Priority Date |
CA-2943005-A1 | Cyano-substituted imidazo[1,2-a]pyridinecarboxamides and their use | 20140321 |
EP-3119777-A1 | Cyano-substituted imidazo[1,2-a]pyridinecarboxamides and their use | 20140321 |
JP-2017508810-A | Cyano-substituted imidazo [1,2-a] pyridinecarboxamide and uses thereof | 20140321 |
US-2017217954-A1 | Cyano-substituted imidazo[1,2-a]pyridinecarboxamides and their use | 20140321 |
US-9771360-B2 | Cyano-substituted imidazo[1,2-A]pyridinecarboxamides and their use | 20140321 |
Complexity: | 184 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 162.079312947 |
Formal Charge: | 0 |
Heavy Atom Count: | 12 |
Hydrogen Bond Acceptor Count: | 3 |
Hydrogen Bond Donor Count: | 1 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 162.079312947 |
Rotatable Bond Count: | 2 |
Topological Polar Surface Area: | 59 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 1.3 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Nitrogen Compounds
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS