5-Amino-2-(2-aminoethyl)pyridine - CAS 215099-43-7
Catalog: |
BB016927 |
Product Name: |
5-Amino-2-(2-aminoethyl)pyridine |
CAS: |
215099-43-7 |
Synonyms: |
6-(2-aminoethyl)-3-pyridinamine; 6-(2-aminoethyl)pyridin-3-amine |
IUPAC Name: | 6-(2-aminoethyl)pyridin-3-amine |
Description: | 5-Amino-2-(2-aminoethyl)pyridine (CAS# 215099-43-7 ) is a useful research chemical. |
Molecular Weight: | 137.18 |
Molecular Formula: | C7H11N3 |
Canonical SMILES: | C1=CC(=NC=C1N)CCN |
InChI: | InChI=1S/C7H11N3/c8-4-3-7-2-1-6(9)5-10-7/h1-2,5H,3-4,8-9H2 |
InChI Key: | YQOWTBVOCAFIPK-UHFFFAOYSA-N |
LogP: | 1.44650 |
Publication Number | Title | Priority Date |
WO-2021105916-A1 | Sulfonamide compounds targeting cd73 and adenosine receptors | 20191126 |
WO-2014066726-A2 | Compounds for modulating il-17 | 20121026 |
JP-2010254684-A | Method for producing alcohol compound | 20090331 |
JP-5630058-B2 | Method for producing alcohol compound | 20090331 |
AU-6853798-A | Novel epoxysuccinamide derivative or salts thereof | 19970418 |
Complexity: | 94.9 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 137.095297364 |
Formal Charge: | 0 |
Heavy Atom Count: | 10 |
Hydrogen Bond Acceptor Count: | 3 |
Hydrogen Bond Donor Count: | 2 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 137.095297364 |
Rotatable Bond Count: | 2 |
Topological Polar Surface Area: | 64.9 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | -0.5 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Amines and Anilines
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS