5-Amino-1-methyl-2-piperidinone - CAS 90485-53-3
Catalog: |
BB039870 |
Product Name: |
5-Amino-1-methyl-2-piperidinone |
CAS: |
90485-53-3 |
Synonyms: |
5-amino-1-methyl-2-piperidinone; 5-amino-1-methylpiperidin-2-one |
IUPAC Name: | 5-amino-1-methylpiperidin-2-one |
Description: | 5-Amino-1-methyl-2-piperidinone (CAS# 90485-53-3) is a useful research chemical. |
Molecular Weight: | 128.17 |
Molecular Formula: | C6H12N2O |
Canonical SMILES: | CN1CC(CCC1=O)N |
InChI: | InChI=1S/C6H12N2O/c1-8-4-5(7)2-3-6(8)9/h5H,2-4,7H2,1H3 |
InChI Key: | ABXJTTPAABNOFP-UHFFFAOYSA-N |
LogP: | 0.20410 |
GHS Hazard Statement: | H302 (100%): Harmful if swallowed [Warning Acute toxicity, oral] |
Precautionary Statement: | P261, P264, P270, P271, P280, P301+P312, P302+P352, P304+P340, P305+P351+P338, P312, P321, P330, P332+P313, P337+P313, P362, P403+P233, P405, and P501 |
Signal Word: | Warning |
Publication Number | Title | Priority Date |
US-2020361898-A1 | Nlrp3 inflammasome inhibitors | 20190517 |
US-2020361899-A1 | Nlrp3 inflammasome inhibitors | 20190517 |
WO-2020234715-A1 | Nlrp3 inflammasome inhibitors | 20190517 |
WO-2020210828-A1 | (aza)indazolyl-aryl sulfonamide and related compounds and their use in treating medical conditions | 20190412 |
AU-2018391675-A1 | Sulphonyl urea derivatives as NLRP3 inflammasome modulators | 20171218 |
Complexity: | 124 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 128.094963011 |
Formal Charge: | 0 |
Heavy Atom Count: | 9 |
Hydrogen Bond Acceptor Count: | 2 |
Hydrogen Bond Donor Count: | 1 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 128.094963011 |
Rotatable Bond Count: | 0 |
Topological Polar Surface Area: | 46.3 Å2 |
Undefined Atom Stereocenter Count: | 1 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | -1.1 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Piperidones
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS