5-Amino-1-methyl-1H-imidazol-2(3H)-one - CAS 1465491-15-9
Catalog: |
BB010097 |
Product Name: |
5-Amino-1-methyl-1H-imidazol-2(3H)-one |
CAS: |
1465491-15-9 |
Synonyms: |
4-amino-3-methyl-1H-imidazol-2-one; 4-amino-3-methyl-1H-imidazol-2-one |
IUPAC Name: | 4-amino-3-methyl-1H-imidazol-2-one |
Description: | 5-Amino-1-methyl-1H-imidazol-2(3H)-one (CAS# 1465491-15-9 ) is a useful research chemical. |
Molecular Weight: | 113.12 |
Molecular Formula: | C4H7N3O |
Canonical SMILES: | CN1C(=CNC1=O)N |
InChI: | InChI=1S/C4H7N3O/c1-7-3(5)2-6-4(7)8/h2H,5H2,1H3,(H,6,8) |
InChI Key: | YLNUTNZJPRHHTE-UHFFFAOYSA-N |
LogP: | -0.12320 |
Publication Number | Title | Priority Date |
EP-1737417-A2 | Keratin dyeing compounds, keratin dyeing compositions containing them, and use thereof | 20040202 |
JP-2007522134-A | Keratin staining compounds, keratin staining compositions containing them, and uses thereof | 20040202 |
KR-20060127951-A | Keratin dyeing compounds, keratin dyeing compositions containing the same and uses thereof | 20040202 |
US-2005198745-A1 | Keratin dyeing compounds, keratin dyeing compositions containing them, and use thereof | 20040202 |
US-7297168-B2 | Keratin dyeing compounds, keratin dyeing compositions containing them, and use thereof | 20040202 |
Complexity: | 151 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 113.058911855 |
Formal Charge: | 0 |
Heavy Atom Count: | 8 |
Hydrogen Bond Acceptor Count: | 2 |
Hydrogen Bond Donor Count: | 2 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 113.058911855 |
Rotatable Bond Count: | 0 |
Topological Polar Surface Area: | 58.4 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | -1.1 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Imidazoles
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS