5-Amino-1-isopropyl-1H-indazole - CAS 928821-18-5
Catalog: |
BB040698 |
Product Name: |
5-Amino-1-isopropyl-1H-indazole |
CAS: |
928821-18-5 |
Synonyms: |
1-propan-2-yl-5-indazolamine; 1-propan-2-ylindazol-5-amine |
IUPAC Name: | 1-propan-2-ylindazol-5-amine |
Description: | 5-Amino-1-isopropyl-1H-indazole (CAS# 928821-18-5) is a useful research chemical. |
Molecular Weight: | 175.23 |
Molecular Formula: | C10H13N3 |
Canonical SMILES: | CC(C)N1C2=C(C=C(C=C2)N)C=N1 |
InChI: | InChI=1S/C10H13N3/c1-7(2)13-10-4-3-9(11)5-8(10)6-12-13/h3-7H,11H2,1-2H3 |
InChI Key: | GZEUSNZVGUYGGV-UHFFFAOYSA-N |
Boiling Point: | 323.85 ℃ at 760 mmHg |
Density: | 1.192 g/cm3 |
LogP: | 2.78060 |
GHS Hazard Statement: | H302 (100%): Harmful if swallowed [Warning Acute toxicity, oral] |
Precautionary Statement: | P261, P264, P270, P271, P280, P301+P312, P302+P352, P304+P340, P305+P351+P338, P312, P321, P330, P332+P313, P337+P313, P362, P403+P233, P405, and P501 |
Signal Word: | Warning |
Publication Number | Title | Priority Date |
EP-2762476-A1 | 1,2,4-triazine-6-carboxamide derivative | 20110930 |
US-2014343038-A1 | 1,2,4-triazine-6-carboxamide derivative | 20110930 |
US-9145414-B2 | 1,2,4-triazine-6-carboxamide derivative | 20110930 |
US-2012122846-A1 | FURO[3,2-d]PYRIMIDINE COMPOUNDS | 20101008 |
US-8551981-B2 | Furo[3,2-d]pyrimidine compounds | 20101008 |
Complexity: | 181 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 175.110947427 |
Formal Charge: | 0 |
Heavy Atom Count: | 13 |
Hydrogen Bond Acceptor Count: | 2 |
Hydrogen Bond Donor Count: | 1 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 175.110947427 |
Rotatable Bond Count: | 1 |
Topological Polar Surface Area: | 43.8 Å2 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 1.6 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Amines and Anilines
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS