5,8-Dibromoquinoxaline - CAS 148231-12-3
Catalog: |
BB010282 |
Product Name: |
5,8-Dibromoquinoxaline |
CAS: |
148231-12-3 |
Synonyms: |
5,8-dibromoquinoxaline |
IUPAC Name: | 5,8-dibromoquinoxaline |
Description: | 5,8-Dibromoquinoxaline (CAS# 148231-12-3) is a useful research chemical compound. |
Molecular Weight: | 287.94 |
Molecular Formula: | C8H4Br2N2 |
Canonical SMILES: | C1=CC(=C2C(=C1Br)N=CC=N2)Br |
InChI: | InChI=1S/C8H4Br2N2/c9-5-1-2-6(10)8-7(5)11-3-4-12-8/h1-4H |
InChI Key: | ZPZBXKVJNVNNET-UHFFFAOYSA-N |
Appearance: | Solid |
MDL: | MFCD18448005 |
LogP: | 3.15480 |
GHS Hazard Statement: | H301 (100%): Toxic if swallowed [Danger Acute toxicity, oral] |
Precautionary Statement: | P261, P264, P270, P271, P280, P301+P310, P302+P352, P304+P340, P305+P351+P338, P310, P312, P321, P330, P332+P313, P362, P403+P233, P405, and P501 |
Signal Word: | Danger |
Publication Number | Title | Priority Date |
KR-20210073908-A | Nanofiber based organic-inorganic composite photocatalyst and process for producing the same | 20191211 |
KR-20210020693-A | Photocatalyst Including conjugate polymer introduced absorption member and photocatalytic reaction using the same | 20190816 |
CN-108831997-A | A kind of sandwich structure memory device and preparation method thereof | 20180626 |
WO-2019238616-A1 | Novel heteroaryl heterocyclyl compounds for the treatment of autoimmune disease | 20180612 |
TW-202016105-A | Novel heteroaryl heterocyclic compound for treating autoimmune diseases | 20180612 |
Complexity: | 147 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 287.87207 |
Formal Charge: | 0 |
Heavy Atom Count: | 12 |
Hydrogen Bond Acceptor Count: | 2 |
Hydrogen Bond Donor Count: | 0 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 285.87412 |
Rotatable Bond Count: | 0 |
Topological Polar Surface Area: | 25.8 Å2 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 2.6 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Quinoxalines
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS