5,6-Dimethylthieno[2,3-d]pyrimidin-4-one - CAS 18593-44-7
Catalog: |
BB014251 |
Product Name: |
5,6-Dimethylthieno[2,3-d]pyrimidin-4-one |
CAS: |
18593-44-7 |
Synonyms: |
5,6-dimethyl-3H-thieno[2,3-d]pyrimidin-4-one; 5,6-dimethyl-3H-thieno[2,3-d]pyrimidin-4-one |
IUPAC Name: | 5,6-dimethyl-3H-thieno[2,3-d]pyrimidin-4-one |
Description: | 5,6-Dimethylthieno[2,3-d]pyrimidin-4-one (CAS# 18593-44-7) is a useful research chemical. |
Molecular Weight: | 180.23 |
Molecular Formula: | C8H8N2OS |
Canonical SMILES: | CC1=C(SC2=C1C(=O)NC=N2)C |
InChI: | InChI=1S/C8H8N2OS/c1-4-5(2)12-8-6(4)7(11)9-3-10-8/h3H,1-2H3,(H,9,10,11) |
InChI Key: | QAFMGDDXMIKGEY-UHFFFAOYSA-N |
MDL: | MFCD00463622 |
LogP: | 1.60140 |
GHS Hazard Statement: | H302 (100%): Harmful if swallowed [Warning Acute toxicity, oral] |
Precautionary Statement: | P261, P264, P270, P271, P280, P301+P312, P302+P352, P304+P340, P305+P351+P338, P312, P321, P330, P332+P313, P337+P313, P362, P403+P233, P405, and P501 |
Signal Word: | Warning |
Publication Number | Title | Priority Date |
US-2018132516-A1 | Positive allosteric modulators of sweet taste | 20161116 |
WO-2015114663-A1 | Novel thieno [2,3-d]pyrimidin-4(3h)-one compounds with antimycobacterial properties | 20140130 |
EP-2663312-A1 | Irak inhibitors and uses thereof | 20110110 |
EP-2663312-B1 | Irak inhibitors and uses thereof | 20110110 |
EP-3239154-A1 | Irak inhibitors and uses thereof | 20110110 |
PMID | Publication Date | Title | Journal |
22591730 | 20120615 | Thieno[3,2-d]pyrimidin-4(3H)-one derivatives as PDK1 inhibitors discovered by fragment-based screening | Bioorganic & medicinal chemistry letters |
20494576 | 20100615 | Synthesis, in vitro and in vivo evaluation of [11C]MMTP: a potential PET ligand for mGluR1 receptors | Bioorganic & medicinal chemistry letters |
12109045 | 20020101 | Synthesis and activity of phenyl derivatives containing 5,6-dimethylthieno[2,3-d]pyrimidin-4(1H)-one or 4H-pyrimido[5,4-b]indol-4-one heterocyclic system as potential nonsteroidal anti-inflammatory drugs | Arzneimittel-Forschung |
Complexity: | 241 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 180.03573406 |
Formal Charge: | 0 |
Heavy Atom Count: | 12 |
Hydrogen Bond Acceptor Count: | 3 |
Hydrogen Bond Donor Count: | 1 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 180.03573406 |
Rotatable Bond Count: | 0 |
Topological Polar Surface Area: | 69.7 Å2 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 1.5 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Carbonyl Compounds
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS