5,6-Dihydrothieno[2,3-c]pyridin-7(4H)-one - CAS 14470-51-0
Catalog: |
BB009823 |
Product Name: |
5,6-Dihydrothieno[2,3-c]pyridin-7(4H)-one |
CAS: |
14470-51-0 |
Synonyms: |
5,6-dihydro-4H-thieno[2,3-c]pyridin-7-one; 5,6-dihydro-4H-thieno[2,3-c]pyridin-7-one |
IUPAC Name: | 5,6-dihydro-4H-thieno[2,3-c]pyridin-7-one |
Description: | 5,6-Dihydrothieno[2,3-c]pyridin-7(4H)-one (CAS# 14470-51-0) is a useful research chemical. |
Molecular Weight: | 153.20 |
Molecular Formula: | C7H7NOS |
Canonical SMILES: | C1CNC(=O)C2=C1C=CS2 |
InChI: | InChI=1S/C7H7NOS/c9-7-6-5(1-3-8-7)2-4-10-6/h2,4H,1,3H2,(H,8,9) |
InChI Key: | ORPWXKFFXAOFCU-UHFFFAOYSA-N |
Boiling Point: | 417.127 °C at 760 mmHg |
Density: | 1.295 g/cm3 |
LogP: | 1.04440 |
Publication Number | Title | Priority Date |
CN-110198944-A | Heterocyclic ring spiroring compounds as monoacylglycerol lipase inhibitor | 20170123 |
US-10669252-B2 | Benzazepine derivative, preparation method, pharmaceutical composition and use thereof | 20160506 |
US-2019152941-A1 | Benzazepine derivative, preparation method, pharmaceutical composition and use thereof | 20160506 |
US-2015307494-A1 | Heteroaromatic compounds and their use as dopamine d1 ligands | 20140425 |
US-2015307522-A1 | Heteroaromatic compounds and their use as dopamine d1 ligands | 20140425 |
Complexity: | 160 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 153.02483502 |
Formal Charge: | 0 |
Heavy Atom Count: | 10 |
Hydrogen Bond Acceptor Count: | 2 |
Hydrogen Bond Donor Count: | 1 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 153.02483502 |
Rotatable Bond Count: | 0 |
Topological Polar Surface Area: | 57.3 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 1.2 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Carbonyl Compounds
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS