5,6-Difluoronicotinonitrile - CAS 1214340-48-3
Catalog: |
BB005148 |
Product Name: |
5,6-Difluoronicotinonitrile |
CAS: |
1214340-48-3 |
Synonyms: |
5,6-difluoro-3-pyridinecarbonitrile; 5,6-difluoropyridine-3-carbonitrile |
IUPAC Name: | 5,6-difluoropyridine-3-carbonitrile |
Description: | 5,6-Difluoronicotinonitrile (CAS# 1214340-48-3) is a useful research chemical. |
Molecular Weight: | 140.09 |
Molecular Formula: | C6H2F2N2 |
Canonical SMILES: | C1=C(C=NC(=C1F)F)C#N |
InChI: | InChI=1S/C6H2F2N2/c7-5-1-4(2-9)3-10-6(5)8/h1,3H |
InChI Key: | NGMVTQXCDCQVEQ-UHFFFAOYSA-N |
Publication Number | Title | Priority Date |
EP-3475275-A1 | 3-aryl and heteroaryl substituted 5-trifluoromethyl oxadiazoles as histone deacetylase 6 (hdac6) inhibitors | 20160623 |
US-2019185462-A1 | 3-aryl- heteroaryl substituted 5-trifluoromethyl oxadiazoles as histonedeacetylase 6 (hdac6) inhibitors | 20160623 |
WO-2017222951-A1 | 3-aryl and heteroaryl substituted 5-trifluoromethyl oxadiazoles as histone deacetylase 6 (hdac6) inhibitors | 20160623 |
US-11066396-B2 | 3-aryl- heteroaryl substituted 5-trifluoromethyl oxadiazoles as histonedeacetylase 6 (HDAC6) inhibitors | 20160623 |
KR-101974793-B1 | Cot modifiers and their use | 20150706 |
Complexity: | 162 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 140.0186044 |
Formal Charge: | 0 |
Heavy Atom Count: | 10 |
Hydrogen Bond Acceptor Count: | 4 |
Hydrogen Bond Donor Count: | 0 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 140.0186044 |
Rotatable Bond Count: | 0 |
Topological Polar Surface Area: | 36.7 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 1.1 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Nitrogen Compounds
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS