5,6-Difluoro-1H-indazole - CAS 944898-96-8
Catalog: |
BB041358 |
Product Name: |
5,6-Difluoro-1H-indazole |
CAS: |
944898-96-8 |
Synonyms: |
5,6-difluoro-1H-indazole; 5,6-difluoro-1H-indazole |
IUPAC Name: | 5,6-difluoro-1H-indazole |
Description: | 5,6-Difluoro-1H-indazole (CAS# 944898-96-8) is a useful research chemical. |
Molecular Weight: | 154.12 |
Molecular Formula: | C7H4F2N2 |
Canonical SMILES: | C1=C2C=NNC2=CC(=C1F)F |
InChI: | InChI=1S/C7H4F2N2/c8-5-1-4-3-10-11-7(4)2-6(5)9/h1-3H,(H,10,11) |
InChI Key: | JNGSIOXFVHBGMU-UHFFFAOYSA-N |
Storage: | Sealed in dry, Room Temperature |
LogP: | 1.84110 |
Publication Number | Title | Priority Date |
WO-2020165062-A1 | Indazolyl-isoxazole derivatives for the treatment of diseases such as cancer | 20190211 |
CN-113474334-A | Indazolyl-isoxazole derivatives for the treatment of diseases such as cancer | 20190211 |
EP-2934144-A1 | Indazole compounds as aldosterone synthase inhibitors | 20121220 |
EP-2934144-B1 | Indazole compounds as aldosterone synthase inhibitors | 20121220 |
US-2015320733-A1 | Indazole compounds as aldosterone synthase inhibitors | 20121220 |
Complexity: | 153 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 154.03425446 |
Formal Charge: | 0 |
Heavy Atom Count: | 11 |
Hydrogen Bond Acceptor Count: | 3 |
Hydrogen Bond Donor Count: | 1 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 154.03425446 |
Rotatable Bond Count: | 0 |
Topological Polar Surface Area: | 28.7 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 1.8 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Indazoles
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS