5-(5-Methylthiophen-2-yl)thiophene-2-carbaldehyde - CAS 32358-94-4
Catalog: |
BB021263 |
Product Name: |
5-(5-Methylthiophen-2-yl)thiophene-2-carbaldehyde |
CAS: |
32358-94-4 |
Synonyms: |
5-(5-methylthiophen-2-yl)thiophene-2-carbaldehyde |
IUPAC Name: | 5-(5-methylthiophen-2-yl)thiophene-2-carbaldehyde |
Description: | 5-(5-Methylthiophen-2-yl)thiophene-2-carbaldehyde (CAS# 32358-94-4 ) is a useful research chemical. |
Molecular Weight: | 208.30 |
Molecular Formula: | C10H8OS2 |
Canonical SMILES: | CC1=CC=C(S1)C2=CC=C(S2)C=O |
InChI: | InChI=1S/C10H8OS2/c1-7-2-4-9(12-7)10-5-3-8(6-11)13-10/h2-6H,1H3 |
InChI Key: | HLFSBWRCOPCECM-UHFFFAOYSA-N |
MDL: | MFCD01812660 |
LogP: | 3.59750 |
GHS Hazard Statement: | H302 (100%): Harmful if swallowed [Warning Acute toxicity, oral] |
Precautionary Statement: | P264, P270, P280, P301+P312, P302+P352, P321, P330, P332+P313, P362, and P501 |
Signal Word: | Warning |
Publication Number | Title | Priority Date |
US-2020369659-A1 | Selective ligands for tau aggregates | 20170804 |
RU-2533424-C1 | Method of obtaining chiral heterocyclic ligands based on 1,2-diaminocyclohexane | 20130715 |
US-2015191439-A1 | Inhibitors targeting drug-resistant influenza a | 20111206 |
US-9884832-B2 | Inhibitors targeting drug-resistant influenza A | 20111206 |
WO-2013086131-A1 | Inhibitors targeting drug-resistant influenza a | 20111206 |
Complexity: | 195 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 208.00165722 |
Formal Charge: | 0 |
Heavy Atom Count: | 13 |
Hydrogen Bond Acceptor Count: | 3 |
Hydrogen Bond Donor Count: | 0 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 208.00165722 |
Rotatable Bond Count: | 2 |
Topological Polar Surface Area: | 73.6 Å2 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 3.2 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Carbonyl Compounds
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS