4-Vinyl-1,3-dioxolan-2-one - CAS 4427-96-7
Catalog: |
BB025557 |
Product Name: |
4-Vinyl-1,3-dioxolan-2-one |
CAS: |
4427-96-7 |
Synonyms: |
4-ethenyl-1,3-dioxolan-2-one |
IUPAC Name: | 4-ethenyl-1,3-dioxolan-2-one |
Description: | 4-Vinyl-1,3-dioxolan-2-one (CAS# 4427-96-7) is a useful research chemical. |
Molecular Weight: | 114.10 |
Molecular Formula: | C5H6O3 |
Canonical SMILES: | C=CC1COC(=O)O1 |
InChI: | InChI=1S/C5H6O3/c1-2-4-3-7-5(6)8-4/h2,4H,1,3H2 |
InChI Key: | BJWMSGRKJIOCNR-UHFFFAOYSA-N |
Boiling Point: | 237 ℃ |
Purity: | 95 % |
Density: | 1.188 g/cm3 |
Appearance: | Colorless liquid |
Storage: | Keep cold. |
MDL: | MFCD00143315 |
LogP: | 0.70780 |
Refractive Index: | 1.45 |
GHS Hazard Statement: | H301 (100%): Toxic if swallowed [Danger Acute toxicity, oral] |
Precautionary Statement: | P264, P270, P301+P310, P321, P330, P405, and P501 |
Signal Word: | Danger |
Publication Number | Title | Priority Date |
CN-113462235-A | Coating for preventing thermal runaway of lithium ion battery and preparation method and application thereof | 20210906 |
CN-113506915-A | Electrolyte additive, preparation method thereof, electrolyte and lithium ion battery | 20210715 |
CN-113471631-A | Electrochemical device and electronic device including the same | 20210705 |
CN-113422105-A | Lithium ion battery and electronic device | 20210629 |
CN-113363417-A | Electrochemical device and electronic device | 20210625 |
Complexity: | 119 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 114.031694049 |
Formal Charge: | 0 |
Heavy Atom Count: | 8 |
Hydrogen Bond Acceptor Count: | 3 |
Hydrogen Bond Donor Count: | 0 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 114.031694049 |
Rotatable Bond Count: | 1 |
Topological Polar Surface Area: | 35.5 Å2 |
Undefined Atom Stereocenter Count: | 1 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 1 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Carbonyl Compounds
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS