4-(tributylstannyl)pyridazine - CAS 194865-89-9
Catalog: |
BB015085 |
Product Name: |
4-(tributylstannyl)pyridazine |
CAS: |
194865-89-9 |
Synonyms: |
tributyl(4-pyridazinyl)stannane; tributyl(pyridazin-4-yl)stannane |
IUPAC Name: | tributyl(pyridazin-4-yl)stannane |
Description: | 4-(tributylstannyl)pyridazine (CAS# 194865-89-9) is a useful research chemical compound. |
Molecular Weight: | 369.13 |
Molecular Formula: | C16H30N2Sn |
Canonical SMILES: | CCCC[Sn](CCCC)(CCCC)C1=CN=NC=C1 |
InChI: | InChI=1S/C4H3N2.3C4H9.Sn/c1-2-4-6-5-3-1;3*1-3-4-2;/h1,3-4H;3*1,3-4H2,2H3; |
InChI Key: | UDLLSOQWYYRFPP-UHFFFAOYSA-N |
Boiling Point: | 406.9 ℃ at 760 mmHg |
Purity: | 96 % |
MDL: | MFCD07787369 |
LogP: | 4.53270 |
GHS Hazard Statement: | H301 (100%): Toxic if swallowed [Danger Acute toxicity, oral] |
Precautionary Statement: | P261, P264, P270, P271, P280, P301+P310, P302+P352, P304+P340, P311, P312, P321, P322, P330, P361, P363, P403+P233, P405, and P501 |
Signal Word: | Danger |
Publication Number | Title | Priority Date |
WO-2021194326-A1 | Aminopyrimidine derivatives and their use as aryl hydrocarbon receptor modulators | 20200327 |
CN-113365994-A | Pyridazinyl thiazole carboxamides | 20191225 |
JP-6948659-B1 | Pyridadinyl thiaazole carboxamide compound | 20191225 |
WO-2021132422-A1 | Pyridazinyl thiazolecarboxamide compound | 20191225 |
WO-2021055744-A1 | 4-substituted indole and indazole sulfonamido derivatives as parg inhibitors | 20190920 |
Complexity: | 199 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 370.143102 |
Formal Charge: | 0 |
Heavy Atom Count: | 19 |
Hydrogen Bond Acceptor Count: | 2 |
Hydrogen Bond Donor Count: | 0 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 370.143102 |
Rotatable Bond Count: | 10 |
Topological Polar Surface Area: | 25.8 Å2 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Pyridazines
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS