4-[[(tert-Butyldimethylsilyl)oxy]methyl]aniline - CAS 131230-76-7
Catalog: |
BB007270 |
Product Name: |
4-[[(tert-Butyldimethylsilyl)oxy]methyl]aniline |
CAS: |
131230-76-7 |
Synonyms: |
4-[[tert-butyl(dimethyl)silyl]oxymethyl]aniline; 4-[[tert-butyl(dimethyl)silyl]oxymethyl]aniline |
IUPAC Name: | 4-[[tert-butyl(dimethyl)silyl]oxymethyl]aniline |
Description: | 4-[[(tert-Butyldimethylsilyl)oxy]methyl]aniline (CAS# 131230-76-7) is used in the synthesis of immunomodulatory agents. |
Molecular Weight: | 237.41 |
Molecular Formula: | C13H23NOSi |
Canonical SMILES: | CC(C)(C)[Si](C)(C)OCC1=CC=C(C=C1)N |
InChI: | InChI=1S/C13H23NOSi/c1-13(2,3)16(4,5)15-10-11-6-8-12(14)9-7-11/h6-9H,10,14H2,1-5H3 |
InChI Key: | WYUUHAORVPRPFB-UHFFFAOYSA-N |
MDL: | MFCD20483304 |
LogP: | 4.37180 |
Publication Number | Title | Priority Date |
WO-2020206381-A1 | Cephem compounds with latent reactive groups and methods of using and making same | 20190403 |
WO-2020156357-A1 | Compound having benzo seven-membered ring structure, preparation method therefor, and use thereof | 20190202 |
WO-2020116662-A1 | Cycloalkane-1,3-diamine derivative | 20181206 |
TW-202039512-A | Cycloalkane-1,3-diamine compounds | 20181206 |
CN-113164481-A | Cycloalkane-1, 3-diamine derivatives | 20181206 |
Complexity: | 215 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 237.154890892 |
Formal Charge: | 0 |
Heavy Atom Count: | 16 |
Hydrogen Bond Acceptor Count: | 2 |
Hydrogen Bond Donor Count: | 1 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 237.154890892 |
Rotatable Bond Count: | 4 |
Topological Polar Surface Area: | 35.2 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Amines and Anilines
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS