4-(tert-Butyl)-alpha,alpha-difluorophenylacetic Acid - CAS 1027514-14-2
Catalog: |
BB000941 |
Product Name: |
4-(tert-Butyl)-alpha,alpha-difluorophenylacetic Acid |
CAS: |
1027514-14-2 |
Synonyms: |
2-(4-tert-butylphenyl)-2,2-difluoroacetic acid; 2-(4-tert-butylphenyl)-2,2-difluoroacetic acid |
IUPAC Name: | 2-(4-tert-butylphenyl)-2,2-difluoroacetic acid |
Description: | 4-(tert-Butyl)-alpha,alpha-difluorophenylacetic Acid (CAS# 1027514-14-2 ) is a useful research chemical. |
Molecular Weight: | 228.24 |
Molecular Formula: | C12H14F2O2 |
Canonical SMILES: | CC(C)(C)C1=CC=C(C=C1)C(C(=O)O)(F)F |
InChI: | InChI=1S/C12H14F2O2/c1-11(2,3)8-4-6-9(7-5-8)12(13,14)10(15)16/h4-7H,1-3H3,(H,15,16) |
InChI Key: | SQCCTMODTJDWCG-UHFFFAOYSA-N |
LogP: | 3.16050 |
Publication Number | Title | Priority Date |
WO-2021170886-A2 | Electronic device | 20200806 |
US-10581001-B2 | Organic electronic component having a charge carrier generation layer and the use of a zinc complex as a P-type dopant in charge carrier generation layers | 20150928 |
US-2018277778-A1 | Organic electronic component having a charge carrier generation layer and the use of a zinc complex as a p-type dopant in charge carrier generation layers | 20150928 |
WO-2017055283-A1 | Organic electronic component having a charge generation layer and use of a zinc complex as a p-dopant in charge generation layers | 20150928 |
EP-3298639-A1 | Formulation containing an organic semiconductor and a metal complex | 20150522 |
Complexity: | 261 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 228.09618601 |
Formal Charge: | 0 |
Heavy Atom Count: | 16 |
Hydrogen Bond Acceptor Count: | 4 |
Hydrogen Bond Donor Count: | 1 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 228.09618601 |
Rotatable Bond Count: | 3 |
Topological Polar Surface Area: | 37.3 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 3.8 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Carbonyl Compounds
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS