4-Stilbenecarboxylic acid - CAS 7329-77-3
Catalog: |
BB034815 |
Product Name: |
4-Stilbenecarboxylic acid |
CAS: |
7329-77-3 |
Synonyms: |
4-(2-phenylethenyl)benzoic acid |
IUPAC Name: | 4-[(E)-2-phenylethenyl]benzoic acid |
Description: | 4-Stilbenecarboxylic acid (CAS# 7329-77-3 ) is a useful research chemical. |
Molecular Weight: | 224.25 |
Molecular Formula: | C15H12O2 |
Canonical SMILES: | C1=CC=C(C=C1)C=CC2=CC=C(C=C2)C(=O)O |
InChI: | InChI=1S/C15H12O2/c16-15(17)14-10-8-13(9-11-14)7-6-12-4-2-1-3-5-12/h1-11H,(H,16,17) |
InChI Key: | IAGXTPCOGVFRSQ-UHFFFAOYSA-N |
Appearance: | Solid |
LogP: | 3.55520 |
GHS Hazard Statement: | H302 (100%): Harmful if swallowed [Warning Acute toxicity, oral]; H319 (100%): Causes serious eye irritation [Warning Serious eye damage/eye irritation] |
Precautionary Statement: | P264, P264+P265, P270, P280, P301+P317, P305+P351+P338, P330, P337+P317, and P501 |
Signal Word: | Warning |
Publication Number | Title | Priority Date |
US-2021189243-A1 | Compound, mixture, liquid crystal composition, cured product, optically anisotropic body, and reflective film | 20180907 |
EP-3049387-A1 | Thermoplastic polymer composition | 20130923 |
EP-3049388-A1 | Thermoplastic polymer composition | 20130923 |
EP-3049468-A1 | Thermoplastic polymer composition | 20130923 |
EP-3049469-A1 | Thermoplastic polymer composition | 20130923 |
Complexity: | 269 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 1 |
Exact Mass: | 224.083729621 |
Formal Charge: | 0 |
Heavy Atom Count: | 17 |
Hydrogen Bond Acceptor Count: | 2 |
Hydrogen Bond Donor Count: | 1 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 224.083729621 |
Rotatable Bond Count: | 3 |
Topological Polar Surface Area: | 37.3 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 4 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Carbonyl Compounds
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS