4-Pyridinepropionic acid - CAS 6318-43-0
Catalog: |
BB032041 |
Product Name: |
4-Pyridinepropionic acid |
CAS: |
6318-43-0 |
Synonyms: |
3-pyridin-4-ylpropanoic acid |
IUPAC Name: | 3-pyridin-4-ylpropanoic acid |
Description: | 4-Pyridinepropionic acid (CAS# 6318-43-0) is a useful research chemical. |
Molecular Weight: | 151.16 |
Molecular Formula: | C8H9NO2 |
Canonical SMILES: | C1=CN=CC=C1CCC(=O)O |
InChI: | InChI=1S/C8H9NO2/c10-8(11)2-1-7-3-5-9-6-4-7/h3-6H,1-2H2,(H,10,11) |
InChI Key: | WSXGQYDHJZKQQB-UHFFFAOYSA-N |
Boiling Point: | 311.9 ℃ at 760 mmHg |
Purity: | > 98 % |
Density: | 1.193 g/cm3 |
Appearance: | Solid |
MDL: | MFCD00084846 |
LogP: | 1.09880 |
GHS Hazard Statement: | H315 (97.56%): Causes skin irritation [Warning Skin corrosion/irritation] |
Precautionary Statement: | P264, P280, P302+P352, P305+P351+P338, P321, P332+P313, P337+P313, and P362 |
Signal Word: | Warning |
Publication Number | Title | Priority Date |
WO-2021132524-A1 | Epoxy azepan derivative | 20191225 |
WO-2021065898-A1 | Azepan derivative | 20190930 |
WO-2021062030-A1 | Diterpenoid compounds that act on protein kinase c (pkc) | 20190924 |
WO-2020205683-A1 | Benzopyrane and imidazole derivatives useful for the stabilization of amyloidogenic immunoglobulin light chains | 20190329 |
WO-2020185069-A1 | Internalizing binding molecules targeting receptors involved in cell proliferation or cell differentiation | 20190308 |
PMID | Publication Date | Title | Journal |
22043853 | 20111205 | Using metal complex reduced states to monitor the oxidation of DNA | Inorganic chemistry |
Complexity: | 130 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 151.063328530 |
Formal Charge: | 0 |
Heavy Atom Count: | 11 |
Hydrogen Bond Acceptor Count: | 3 |
Hydrogen Bond Donor Count: | 1 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 151.063328530 |
Rotatable Bond Count: | 3 |
Topological Polar Surface Area: | 50.2 Å2 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 0.4 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Carbonyl Compounds
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS