4-N-Propylbenzenesulfonyl chloride - CAS 146949-07-7
Catalog: |
BB010139 |
Product Name: |
4-N-Propylbenzenesulfonyl chloride |
CAS: |
146949-07-7 |
Synonyms: |
4-propylbenzenesulfonyl chloride |
IUPAC Name: | 4-propylbenzenesulfonyl chloride |
Description: | 4-N-Propylbenzenesulfonyl chloride (CAS# 146949-07-7) is a useful research chemical. |
Molecular Weight: | 218.70 |
Molecular Formula: | C9H11ClO2S |
Canonical SMILES: | CCCC1=CC=C(C=C1)S(=O)(=O)Cl |
InChI: | InChI=1S/C9H11ClO2S/c1-2-3-8-4-6-9(7-5-8)13(10,11)12/h4-7H,2-3H2,1H3 |
InChI Key: | LEFGAGRZHLNPLS-UHFFFAOYSA-N |
Boiling Point: | 275-276 ℃ |
Density: | 1.223 g/mL at 25 ℃ (lit.) |
MDL: | MFCD00041508 |
LogP: | 3.64740 |
GHS Hazard Statement: | H290 (16.67%): May be corrosive to metals [Warning Corrosive to Metals] |
Precautionary Statement: | P234, P260, P264, P280, P301+P330+P331, P303+P361+P353, P304+P340, P305+P351+P338, P310, P321, P363, P390, P404, P405, and P501 |
Signal Word: | Danger |
Publication Number | Title | Priority Date |
WO-2021061823-A1 | Chemical compounds | 20190923 |
WO-2021034729-A1 | N-aryl sulfonamide derivatives as vaccine adjuvant | 20190816 |
CN-111285806-A | Pyrazole compound and preparation method, application and pharmaceutical composition thereof | 20181206 |
CN-110092743-A | Benzamide compound and preparation method thereof, purposes and pharmaceutical composition | 20180130 |
WO-2019149223-A1 | Benzamide compound and preparation method, use, and pharmaceutical composition thereof | 20180130 |
Complexity: | 235 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 218.0168285 |
Formal Charge: | 0 |
Heavy Atom Count: | 13 |
Hydrogen Bond Acceptor Count: | 2 |
Hydrogen Bond Donor Count: | 0 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 218.0168285 |
Rotatable Bond Count: | 3 |
Topological Polar Surface Area: | 42.5 Å2 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 3.1 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Sulfur Compounds
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS