4-methylisoxazole-5-carboxylic acid - CAS 261350-46-3
Catalog: |
BB019146 |
Product Name: |
4-methylisoxazole-5-carboxylic acid |
CAS: |
261350-46-3 |
Synonyms: |
4-methyl-5-isoxazolecarboxylic acid; 4-methyl-1,2-oxazole-5-carboxylic acid |
IUPAC Name: | 4-methyl-1,2-oxazole-5-carboxylic acid |
Description: | 4-methylisoxazole-5-carboxylic acid (CAS# 261350-46-3) is a useful research chemical. |
Molecular Weight: | 127.10 |
Molecular Formula: | C5H5NO3 |
Canonical SMILES: | CC1=C(ON=C1)C(=O)O |
InChI: | InChI=1S/C5H5NO3/c1-3-2-6-9-4(3)5(7)8/h2H,1H3,(H,7,8) |
InChI Key: | RITPLLYUVXGBFT-UHFFFAOYSA-N |
Boiling Point: | 310 ℃ |
Purity: | 95 % |
Density: | 1.348 g/cm3 |
Appearance: | White solid |
MDL: | MFCD08235209 |
LogP: | 0.68120 |
GHS Hazard Statement: | H315 (100%): Causes skin irritation [Warning Skin corrosion/irritation] |
Precautionary Statement: | P261, P264, P271, P280, P302+P352, P304+P340, P305+P351+P338, P312, P321, P332+P313, P337+P313, P362, P403+P233, P405, and P501 |
Signal Word: | Warning |
Publication Number | Title | Priority Date |
EP-3822268-A1 | Substituted hydantoinamides as adamts7 antagonists | 20191115 |
WO-2021094436-A1 | Substituted hydantoinamides as adamts7 antagonists | 20191115 |
CN-110167944-A | Substituted pyrazolo azepine * -4- ketone and its purposes as phosphodiesterase inhibitors | 20161212 |
US-2019276462-A1 | [1,2,4]triazolo[1,5‐a]pyrimidine compounds as pde2 inhibitors | 20161102 |
EP-3535267-B1 | [1,2,4]triazolo[1,5-a]pyrimidine derivatives as pde2 inhibitors | 20161102 |
Complexity: | 125 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 127.026943022 |
Formal Charge: | 0 |
Heavy Atom Count: | 9 |
Hydrogen Bond Acceptor Count: | 4 |
Hydrogen Bond Donor Count: | 1 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 127.026943022 |
Rotatable Bond Count: | 1 |
Topological Polar Surface Area: | 63.3 Å2 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 0.6 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Carbonyl Compounds
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS