4-(Methylamino)-1-benzylpiperidine - CAS 7006-50-0
Catalog: |
BB034065 |
Product Name: |
4-(Methylamino)-1-benzylpiperidine |
CAS: |
7006-50-0 |
Synonyms: |
N-methyl-1-(phenylmethyl)-4-piperidinamine; 1-benzyl-N-methylpiperidin-4-amine |
IUPAC Name: | 1-benzyl-N-methylpiperidin-4-amine |
Description: | 4-(Methylamino)-1-benzylpiperidine (CAS# 7006-50-0) is a useful intermediate used in the synthesis of Taladegib; a small molecular hedgehog signaling pathway inhibitor. |
Molecular Weight: | 204.31 |
Molecular Formula: | C13H20N2 |
Canonical SMILES: | CNC1CCN(CC1)CC2=CC=CC=C2 |
InChI: | InChI=1S/C13H20N2/c1-14-13-7-9-15(10-8-13)11-12-5-3-2-4-6-12/h2-6,13-14H,7-11H2,1H3 |
InChI Key: | RGEQSTMITLEXKD-UHFFFAOYSA-N |
Boiling Point: | 303.1 ℃ at 760 mmHg |
Density: | 1.018 g/cm3 |
Appearance: | Colorless clear liquid |
MDL: | MFCD03931054 |
LogP: | 2.19920 |
GHS Hazard Statement: | H315 (100%): Causes skin irritation [Warning Skin corrosion/irritation] |
Precautionary Statement: | P261, P264, P271, P280, P302+P352, P304+P340, P305+P351+P338, P312, P321, P332+P313, P337+P313, P362, P403+P233, P405, and P501 |
Signal Word: | Warning |
Publication Number | Title | Priority Date |
CN-111484479-A | Nitrogen heterocyclic compound, pharmaceutical composition containing nitrogen heterocyclic compound, preparation method and application of nitrogen heterocyclic compound | 20190125 |
US-2020071313-A1 | Heteroaryl-substituted sulfonamide compounds and their use as sodium channel inhibitors | 20180831 |
US-10752623-B2 | Heteroaryl-substituted sulfonamide compounds and their use as sodium channel inhibitors | 20180831 |
CA-3104913-A1 | Heteroaryl-substituted sulfonamide compounds and their use as sodium channel inhibitors | 20180831 |
CN-112638898-A | Heteroaryl substituted sulfonamide compounds and their use as sodium channel inhibitors | 20180831 |
Complexity: | 167 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 204.162648646 |
Formal Charge: | 0 |
Heavy Atom Count: | 15 |
Hydrogen Bond Acceptor Count: | 2 |
Hydrogen Bond Donor Count: | 1 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 204.162648646 |
Rotatable Bond Count: | 3 |
Topological Polar Surface Area: | 15.3 Å2 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 1.9 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Amines and Anilines
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS