4-Methoxypyrimidine-5-boronic Acid - CAS 909187-37-7
Catalog: |
BB039988 |
Product Name: |
4-Methoxypyrimidine-5-boronic Acid |
CAS: |
909187-37-7 |
Synonyms: |
(4-methoxy-5-pyrimidinyl)boronic acid; (4-methoxypyrimidin-5-yl)boronic acid |
IUPAC Name: | (4-methoxypyrimidin-5-yl)boronic acid |
Description: | 4-Methoxypyrimidine-5-boronic Acid (CAS# 909187-37-7) is potentially useful in Suzuki-Miyaura cross-coupling reaction for the palladium catalyzed formation of carbon-carbon bonds. |
Molecular Weight: | 153.93 |
Molecular Formula: | C5H7N2O3B |
Canonical SMILES: | B(C1=CN=CN=C1OC)(O)O |
InChI: | InChI=1S/C5H7BN2O3/c1-11-5-4(6(9)10)2-7-3-8-5/h2-3,9-10H,1H3 |
InChI Key: | SIHFIKAJVVQLMX-UHFFFAOYSA-N |
LogP: | -1.83500 |
Publication Number | Title | Priority Date |
AU-2017378324-A1 | Bycyclic heteroaryl derivatives as CFTR potentiators | 20161216 |
CA-3046968-A1 | Bycyclic heteroaryl derivatives as cftr potentiators | 20161216 |
CN-110300589-A | Bicyclic different heteroaryl derivative as CFTR synergist | 20161216 |
EP-3554506-A1 | Bycyclic heteroaryl derivatives as cftr potentiators | 20161216 |
JP-2020502103-A | Bicyclic heteroaryl derivatives as CFTR enhancers | 20161216 |
Complexity: | 124 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 154.0549723 |
Formal Charge: | 0 |
Heavy Atom Count: | 11 |
Hydrogen Bond Acceptor Count: | 5 |
Hydrogen Bond Donor Count: | 2 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 154.0549723 |
Rotatable Bond Count: | 2 |
Topological Polar Surface Area: | 75.5 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Boronic Acids and Esters
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS