4-Methoxyindolin-2-one - CAS 7699-17-4
Catalog: |
BB035775 |
Product Name: |
4-Methoxyindolin-2-one |
CAS: |
7699-17-4 |
Synonyms: |
4-methoxy-1,3-dihydroindol-2-one; 4-methoxy-1,3-dihydroindol-2-one |
IUPAC Name: | 4-methoxy-1,3-dihydroindol-2-one |
Description: | 4-Methoxyindolin-2-one (CAS# 7699-17-4) is a useful research chemical. |
Molecular Weight: | 163.17 |
Molecular Formula: | C9H9NO2 |
Canonical SMILES: | COC1=CC=CC2=C1CC(=O)N2 |
InChI: | InChI=1S/C9H9NO2/c1-12-8-4-2-3-7-6(8)5-9(11)10-7/h2-4H,5H2,1H3,(H,10,11) |
InChI Key: | WINOEVFNWAEXIF-UHFFFAOYSA-N |
Boiling Point: | 355.4 °C at 760 mmHg |
Density: | 1.208 g/cm3 |
Appearance: | Off-white solid |
MDL: | MFCD07368221 |
LogP: | 1.32780 |
GHS Hazard Statement: | H302 (100%): Harmful if swallowed [Warning Acute toxicity, oral] |
Precautionary Statement: | P261, P264, P270, P271, P280, P301+P312, P302+P352, P304+P312, P304+P340, P305+P351+P338, P312, P321, P330, P332+P313, P337+P313, P362, P403+P233, P405, and P501 |
Signal Word: | Warning |
Publication Number | Title | Priority Date |
US-10618897-B2 | Spiroindolinones as DDR1 inhibitors | 20160208 |
US-2019071444-A1 | Spiroindolinones as ddr1 inhibitors | 20160208 |
EP-3414247-B1 | Spiroindolinones as ddr1 inhibitors | 20160208 |
EP-3252038-A1 | N-benzoate group substituted benzopyrroline-2-one derivative and use thereof | 20150128 |
WO-2016119641-A1 | N-benzoate group substituted benzopyrroline-2-one derivative and use thereof | 20150128 |
Complexity: | 193 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 163.063328530 |
Formal Charge: | 0 |
Heavy Atom Count: | 12 |
Hydrogen Bond Acceptor Count: | 2 |
Hydrogen Bond Donor Count: | 1 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 163.063328530 |
Rotatable Bond Count: | 1 |
Topological Polar Surface Area: | 38.3 Å2 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 0.7 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Indolines
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS