4-Methoxy-6-methylpyrimidine - CAS 5541-07-1
Catalog: |
BB029034 |
Product Name: |
4-Methoxy-6-methylpyrimidine |
CAS: |
5541-07-1 |
Synonyms: |
4-methoxy-6-methylpyrimidine; 4-methoxy-6-methylpyrimidine |
IUPAC Name: | 4-methoxy-6-methylpyrimidine |
Description: | 4-Methoxy-6-methylpyrimidine (CAS# 5541-07-1) is a useful research chemical compound. |
Molecular Weight: | 124.14 |
Molecular Formula: | C6H8N2O |
Canonical SMILES: | CC1=CC(=NC=N1)OC |
InChI: | InChI=1S/C6H8N2O/c1-5-3-6(9-2)8-4-7-5/h3-4H,1-2H3 |
InChI Key: | GGFJPYWUQCOYLQ-UHFFFAOYSA-N |
LogP: | 0.79360 |
Publication Number | Title | Priority Date |
WO-2020187292-A1 | 2-substituted pyrazoleamino-4-substituted amino-5-pyrimidine formamide compound, composition and use thereof | 20190319 |
WO-2020065614-A1 | Monoacylglycerol lipase modulators | 20180928 |
JP-2021521131-A | 4-Oxo-3,4-dihydroquinazoline compounds as inhibitors of human immunodeficiency virus replication | 20180411 |
CN-108101854-B | Preparation of amino acid ester compound containing pyrimidine structure and application of amino acid ester compound in resisting tobacco mosaic virus | 20171218 |
EP-3689872-A1 | Heterocyclic compound and harmful arthropod controlling agent containing same | 20170926 |
Complexity: | 87.1 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 124.063662883 |
Formal Charge: | 0 |
Heavy Atom Count: | 9 |
Hydrogen Bond Acceptor Count: | 3 |
Hydrogen Bond Donor Count: | 0 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 124.063662883 |
Rotatable Bond Count: | 1 |
Topological Polar Surface Area: | 35 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 0.8 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Other Pyrimidines
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS