4-Iodophenylacetonitrile - CAS 51628-12-7
Catalog: |
BB027521 |
Product Name: |
4-Iodophenylacetonitrile |
CAS: |
51628-12-7 |
Synonyms: |
2-(4-iodophenyl)acetonitrile |
IUPAC Name: | 2-(4-iodophenyl)acetonitrile |
Description: | 4-Iodophenylacetonitrile (CAS# 51628-12-7) is a useful research chemical. |
Molecular Weight: | 243.04 |
Molecular Formula: | C8H6IN |
Canonical SMILES: | C1=CC(=CC=C1CC#N)I |
InChI: | InChI=1S/C8H6IN/c9-8-3-1-7(2-4-8)5-6-10/h1-4H,5H2 |
InChI Key: | PNXWQTYSBFGIFD-UHFFFAOYSA-N |
Boiling Point: | 285.8 ℃ at 760 mmHg |
Melting Point: | 53-57 ℃ (lit.) |
Purity: | 95 % |
Density: | 1.764 g/cm3 |
Appearance: | Solid |
MDL: | MFCD00060306 |
LogP: | 2.35728 |
GHS Hazard Statement: | H302 (95.56%): Harmful if swallowed [Warning Acute toxicity, oral] |
Precautionary Statement: | P261, P264, P270, P272, P280, P301+P312, P302+P352, P321, P330, P333+P313, P363, and P501 |
Signal Word: | Warning |
Publication Number | Title | Priority Date |
CN-110627823-A | Method for catalyzing arylamine to generate deamination boric acid esterification or halogenation | 20191017 |
CN-110627823-B | Method for catalyzing arylamine to generate deamination boric acid esterification or halogenation | 20191017 |
CN-108002991-B | Visible light catalytic halogenated aromatic hydrocarbon dehalogenation method without photooxidation-reduction catalyst | 20171220 |
US-2020048230-A1 | Heterocyclic compound and organic light emitting element including same | 20170630 |
CN-106554266-B | Preparation method of methoxyphenylacetic acid, intermediate thereof and salt thereof | 20150906 |
Complexity: | 139 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 242.95450 |
Formal Charge: | 0 |
Heavy Atom Count: | 10 |
Hydrogen Bond Acceptor Count: | 1 |
Hydrogen Bond Donor Count: | 0 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 242.95450 |
Rotatable Bond Count: | 1 |
Topological Polar Surface Area: | 23.8 Å2 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 2.2 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Nitrogen Compounds
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS