4-Iodo-2-methoxybenzoic acid - CAS 89942-34-7
Catalog: |
BB039697 |
Product Name: |
4-Iodo-2-methoxybenzoic acid |
CAS: |
89942-34-7 |
Synonyms: |
4-iodo-2-methoxybenzoic acid |
IUPAC Name: | 4-iodo-2-methoxybenzoic acid |
Description: | 4-Iodo-2-methoxybenzoic acid (CAS# 89942-34-7) is a useful research chemical. |
Molecular Weight: | 278.04 |
Molecular Formula: | C8H7IO3 |
Canonical SMILES: | COC1=C(C=CC(=C1)I)C(=O)O |
InChI: | InChI=1S/C8H7IO3/c1-12-7-4-5(9)2-3-6(7)8(10)11/h2-4H,1H3,(H,10,11) |
InChI Key: | KKAZLRGZDIWYJT-UHFFFAOYSA-N |
Boiling Point: | 354.661 °C at 760 mmHg |
Density: | 1.878 g/cm3 |
MDL: | MFCD07780726 |
LogP: | 1.99800 |
GHS Hazard Statement: | H315 (100%): Causes skin irritation [Warning Skin corrosion/irritation] |
Precautionary Statement: | P261, P264, P271, P280, P302+P352, P304+P340, P305+P351+P338, P312, P321, P332+P313, P337+P313, P362, P403+P233, P405, and P501 |
Signal Word: | Warning |
Publication Number | Title | Priority Date |
US-2020241418-A1 | Positive resist composition and patterning process | 20190129 |
US-2020192222-A1 | Resist composition and patterning process | 20181218 |
WO-2020122182-A1 | Amino acid having functional group capable of intermolecular hydrogen bonding, peptide compound containing same and method for production thereof | 20181212 |
EP-3896056-A1 | Amino acid having functional group capable of intermolecular hydrogen bonding, peptide compound containing same and method for production thereof | 20181212 |
KR-20210102326-A | Amino acids having an intramolecular hydrogen bondable functional group, peptide compounds containing these amino acids, and methods for their preparation | 20181212 |
Complexity: | 172 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 277.94399 |
Formal Charge: | 0 |
Heavy Atom Count: | 12 |
Hydrogen Bond Acceptor Count: | 3 |
Hydrogen Bond Donor Count: | 1 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 277.94399 |
Rotatable Bond Count: | 2 |
Topological Polar Surface Area: | 46.5 Å2 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 2.2 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Carbonyl Compounds
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS