4-(Hydroxymethyl)isoquinoline - CAS 73048-60-9
Catalog: |
BB034747 |
Product Name: |
4-(Hydroxymethyl)isoquinoline |
CAS: |
73048-60-9 |
Synonyms: |
4-isoquinolinylmethanol; isoquinolin-4-ylmethanol |
IUPAC Name: | isoquinolin-4-ylmethanol |
Description: | 4-(Hydroxymethyl)isoquinoline (CAS# 73048-60-9) is a useful research chemical. |
Molecular Weight: | 159.18 |
Molecular Formula: | C10H9NO |
Canonical SMILES: | C1=CC=C2C(=C1)C=NC=C2CO |
InChI: | InChI=1S/C10H9NO/c12-7-9-6-11-5-8-3-1-2-4-10(8)9/h1-6,12H,7H2 |
InChI Key: | QWTIYWBQFLATTN-UHFFFAOYSA-N |
Boiling Point: | 358.37 °C at 760 mmHg |
Density: | 1.219 g/cm3 |
LogP: | 1.72710 |
GHS Hazard Statement: | H302 (100%): Harmful if swallowed [Warning Acute toxicity, oral] |
Precautionary Statement: | P261, P264, P270, P271, P280, P301+P312, P302+P352, P304+P340, P305+P351+P338, P312, P321, P330, P332+P313, P337+P313, P362, P403+P233, P405, and P501 |
Signal Word: | Warning |
Publication Number | Title | Priority Date |
US-2018230115-A1 | cGAS ANTAGONIST COMPOUNDS | 20160405 |
US-10947206-B2 | cGAS antagonist compounds | 20160405 |
CN-107922407-A | Respiratory Syncytial Virus(RSV) inhibitor | 20150730 |
EP-2872490-A1 | Antiproliferative benzo [b]azepin- 2 - ones | 20120713 |
EP-2872490-B1 | Antiproliferative benzo[b]azepin-2-ones | 20120713 |
Complexity: | 149 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 159.068413911 |
Formal Charge: | 0 |
Heavy Atom Count: | 12 |
Hydrogen Bond Acceptor Count: | 2 |
Hydrogen Bond Donor Count: | 1 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 159.068413911 |
Rotatable Bond Count: | 1 |
Topological Polar Surface Area: | 33.1 Å2 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 1.2 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Alcohols and Derivatives
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS