4-(Hydroxymethyl)-3-methylphenylboronic Acid Pinacol Ester - CAS 1160430-87-4
Catalog: |
BB003697 |
Product Name: |
4-(Hydroxymethyl)-3-methylphenylboronic Acid Pinacol Ester |
CAS: |
1160430-87-4 |
Synonyms: |
[2-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methanol; [2-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methanol |
IUPAC Name: | [2-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methanol |
Description: | 4-(Hydroxymethyl)-3-methylphenylboronic Acid Pinacol Ester (CAS# 1160430-87-4) is a useful research chemical. |
Molecular Weight: | 248.13 |
Molecular Formula: | C14H21O3B |
Canonical SMILES: | B1(OC(C(O1)(C)C)(C)C)C2=CC(=C(C=C2)CO)C |
InChI: | InChI=1S/C14H21BO3/c1-10-8-12(7-6-11(10)9-16)15-17-13(2,3)14(4,5)18-15/h6-8,16H,9H2,1-5H3 |
InChI Key: | BGWBPOSVIJKTMI-UHFFFAOYSA-N |
LogP: | 1.78650 |
Publication Number | Title | Priority Date |
WO-2020039027-A1 | Pyrrolidine glycosidase inhibitors | 20180822 |
US-2021213005-A1 | Pyrrolidine glycosidase inhibitors | 20180822 |
AU-2016317806-A1 | Heteroaryl compounds and their use as therapeutic drugs | 20150831 |
EP-3344613-A1 | Heteroaryl compounds and their use as therapeutic drugs | 20150831 |
EP-3344613-B1 | Heteroaryl compounds and their use as therapeutic drugs | 20150831 |
Complexity: | 287 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 248.1583747 |
Formal Charge: | 0 |
Heavy Atom Count: | 18 |
Hydrogen Bond Acceptor Count: | 3 |
Hydrogen Bond Donor Count: | 1 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 248.1583747 |
Rotatable Bond Count: | 2 |
Topological Polar Surface Area: | 38.7 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Boronic Acids and Esters
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS