4-Hydroxy-4-methyl-Hexahydro-1H-azepine - CAS 740758-27-4
Catalog: |
BB034980 |
Product Name: |
4-Hydroxy-4-methyl-Hexahydro-1H-azepine |
CAS: |
740758-27-4 |
Synonyms: |
4-methyl-4-azepanol; 4-methylazepan-4-ol |
IUPAC Name: | 4-methylazepan-4-ol |
Description: | 4-Hydroxy-4-methyl-Hexahydro-1H-azepine (CAS# 740758-27-4) is a useful research chemical. |
Molecular Weight: | 129.20 |
Molecular Formula: | C7H15NO |
Canonical SMILES: | CC1(CCCNCC1)O |
InChI: | InChI=1S/C7H15NO/c1-7(9)3-2-5-8-6-4-7/h8-9H,2-6H2,1H3 |
InChI Key: | NUSFCKJOSCESDP-UHFFFAOYSA-N |
Appearance: | Solid |
LogP: | 0.83970 |
Publication Number | Title | Priority Date |
US-10392349-B2 | Azepane derivatives and methods of treating hepatitis B infections | 20140116 |
US-2015197493-A1 | Azepane derivatives and methods of treating hepatitis b infections | 20140116 |
US-2015197533-A1 | Azepane derivatives and methods of treating hepatitis b infections | 20140116 |
US-2015225355-A1 | Azepane derivatives and methods of treating hepatitis b infections | 20140116 |
US-2016000812-A1 | Azepane derivatives and methods of treating hepatitis b infections | 20140116 |
Complexity: | 94.9 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 129.115364102 |
Formal Charge: | 0 |
Heavy Atom Count: | 9 |
Hydrogen Bond Acceptor Count: | 2 |
Hydrogen Bond Donor Count: | 2 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 129.115364102 |
Rotatable Bond Count: | 0 |
Topological Polar Surface Area: | 32.3 |
Undefined Atom Stereocenter Count: | 1 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 0.2 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Alcohols and Derivatives
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS