4-Hydroxy-2-nitropyridine - CAS 101654-28-8
Catalog: |
BB000583 |
Product Name: |
4-Hydroxy-2-nitropyridine |
CAS: |
101654-28-8 |
Synonyms: |
2-nitro-1H-pyridin-4-one; 2-nitro-1H-pyridin-4-one |
IUPAC Name: | 2-nitro-1H-pyridin-4-one |
Description: | 4-Hydroxy-2-nitropyridine (CAS# 101654-28-8) is a useful research chemical. |
Molecular Weight: | 140.10 |
Molecular Formula: | C5H4N2O3 |
Canonical SMILES: | C1=CNC(=CC1=O)[N+](=O)[O-] |
InChI: | InChI=1S/C5H4N2O3/c8-4-1-2-6-5(3-4)7(9)10/h1-3H,(H,6,8) |
InChI Key: | NJTUZNXKDOUPHP-UHFFFAOYSA-N |
Boiling Point: | 255.1 ℃ at 760 mmHg |
Density: | 1.44 g/cm3 |
Storage: | Inert atmosphere, 2-8 ℃ |
LogP: | 1.21860 |
GHS Hazard Statement: | H315 (100%): Causes skin irritation [Warning Skin corrosion/irritation] |
Precautionary Statement: | P261, P264, P271, P280, P302+P352, P304+P340, P305+P351+P338, P312, P321, P332+P313, P337+P313, P362, P403+P233, P405, and P501 |
Signal Word: | Warning |
Publication Number | Title | Priority Date |
AU-2018273020-A1 | Method for preparing heterocyclic derivative compound, composition containing same compound, and hydrate of same compound | 20170525 |
CA-3061301-A1 | Method for preparing heterocyclic derivative compound, composition containing same compound, and hydrate of same compound | 20170525 |
CN-110691783-A | Process for the preparation of heterocyclic derivative compounds, compositions containing them and hydrates of the compounds | 20170525 |
EP-3632917-A1 | Method for preparing heterocyclic derivative compound, composition containing same compound, and hydrate of same compound | 20170525 |
KR-20190132693-A | Method for preparing heterocycle derivative compound, composition comprising the compound and hydrate of the compound | 20170525 |
Complexity: | 236 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 140.02219199 |
Formal Charge: | 0 |
Heavy Atom Count: | 10 |
Hydrogen Bond Acceptor Count: | 4 |
Hydrogen Bond Donor Count: | 1 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 140.02219199 |
Rotatable Bond Count: | 0 |
Topological Polar Surface Area: | 74.9 Å2 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 0.2 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Pyridines
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS