4-Hydroxy-2-(hydroxymethyl)benzimidazole - CAS 116345-47-2
Catalog: |
BB003745 |
Product Name: |
4-Hydroxy-2-(hydroxymethyl)benzimidazole |
CAS: |
116345-47-2 |
Synonyms: |
2-(hydroxymethyl)-1H-benzimidazol-4-ol; 2-(hydroxymethyl)-1H-benzimidazol-4-ol |
IUPAC Name: | 2-(hydroxymethyl)-1H-benzimidazol-4-ol |
Description: | 4-Hydroxy-2-(hydroxymethyl)benzimidazole (CAS# 116345-47-2 ) is a useful research chemical. |
Molecular Weight: | 164.16 |
Molecular Formula: | C8H8N2O2 |
Canonical SMILES: | C1=CC2=C(C(=C1)O)N=C(N2)CO |
InChI: | InChI=1S/C8H8N2O2/c11-4-7-9-5-2-1-3-6(12)8(5)10-7/h1-3,11-12H,4H2,(H,9,10) |
InChI Key: | KROOLBGYYVWEIA-UHFFFAOYSA-N |
LogP: | 0.00000 |
Publication Number | Title | Priority Date |
US-2015004533-A1 | Actinic ray-sensitive or radiation-sensitive resin composition, and, actinic ray-sensitive or radiation-sensitive film and pattern forming method, each using the same | 20120329 |
US-9323153-B2 | Actinic ray-sensitive or radiation-sensitive resin composition, and, actinic ray-sensitive or radiation-sensitive film and pattern forming method, each using the same | 20120329 |
WO-2013147286-A1 | Actinic ray-sensitive or radiation-sensitive resin composition, and, actinic ray-sensitive or radiation-sensitive film and pattern forming method, each using the same | 20120329 |
CN-87107175-A | New benzimidazole derivatives as anti ulcer agent | 19861027 |
EP-0266326-B1 | Novel derivatives of benzimidazoles active as anti-ulcer agents | 19861027 |
Complexity: | 165 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 164.058577502 |
Formal Charge: | 0 |
Heavy Atom Count: | 12 |
Hydrogen Bond Acceptor Count: | 3 |
Hydrogen Bond Donor Count: | 3 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 164.058577502 |
Rotatable Bond Count: | 1 |
Topological Polar Surface Area: | 69.1 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 0.2 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Alcohols and Derivatives
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS