4-Hydroxy-2,3-dihydro-1H-indene-5-carbaldehyde - CAS 1092553-18-8
Catalog: |
BB002419 |
Product Name: |
4-Hydroxy-2,3-dihydro-1H-indene-5-carbaldehyde |
CAS: |
1092553-18-8 |
Synonyms: |
4-hydroxy-2,3-dihydro-1H-indene-5-carboxaldehyde; 4-hydroxy-2,3-dihydro-1H-indene-5-carbaldehyde |
IUPAC Name: | 4-hydroxy-2,3-dihydro-1H-indene-5-carbaldehyde |
Description: | 4-Hydroxy-2,3-dihydro-1H-indene-5-carbaldehyde (CAS# 1092553-18-8 ) is a useful research chemical. |
Molecular Weight: | 162.19 |
Molecular Formula: | C10H10O2 |
Canonical SMILES: | C1CC2=C(C1)C(=C(C=C2)C=O)O |
InChI: | InChI=1S/C10H10O2/c11-6-8-5-4-7-2-1-3-9(7)10(8)12/h4-6,12H,1-3H2 |
InChI Key: | JJLVLYOYXXOOBF-UHFFFAOYSA-N |
LogP: | 1.69340 |
Publication Number | Title | Priority Date |
WO-2020241853-A1 | Benzotriazole derivative | 20190531 |
WO-2020067457-A1 | Condensed-cyclic compound | 20180928 |
EP-3858823-A1 | Condensed-cyclic compound | 20180928 |
WO-2019175897-A1 | Bicyclic compounds as inhibitors of pd1/pd-l1 interaction/activation | 20180313 |
AU-2019234185-A1 | Bicyclic compounds as inhibitors of PD1/PD-L1 interaction/activation | 20180313 |
Complexity: | 179 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 162.068079557 |
Formal Charge: | 0 |
Heavy Atom Count: | 12 |
Hydrogen Bond Acceptor Count: | 2 |
Hydrogen Bond Donor Count: | 1 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 162.068079557 |
Rotatable Bond Count: | 1 |
Topological Polar Surface Area: | 37.3 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 2.4 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Carbonyl Compounds
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS