(4-Hydroxy-1-piperidyl)(3-piperidyl)methanone - CAS 496057-57-9
Catalog: |
BB026743 |
Product Name: |
(4-Hydroxy-1-piperidyl)(3-piperidyl)methanone |
CAS: |
496057-57-9 |
Synonyms: |
(4-hydroxy-1-piperidinyl)-(3-piperidinyl)methanone; (4-hydroxypiperidin-1-yl)-piperidin-3-ylmethanone |
IUPAC Name: | (4-hydroxypiperidin-1-yl)-piperidin-3-ylmethanone |
Description: | (4-Hydroxy-1-piperidyl)(3-piperidyl)methanone (CAS# 496057-57-9) is a useful research chemical. |
Molecular Weight: | 212.29 |
Molecular Formula: | C11H20N2O2 |
Canonical SMILES: | C1CC(CNC1)C(=O)N2CCC(CC2)O |
InChI: | InChI=1S/C11H20N2O2/c14-10-3-6-13(7-4-10)11(15)9-2-1-5-12-8-9/h9-10,12,14H,1-8H2 |
InChI Key: | UBNDKFIAPLMLBO-UHFFFAOYSA-N |
Boiling Point: | 405.2 ℃ at 760 mmHg |
Density: | 1.151 g/cm3 |
MDL: | MFCD03425213 |
LogP: | 0.23600 |
Publication Number | Title | Priority Date |
EP-2152272-A2 | Novel 2,3-diamino-quinazolinone derivatives and their medical use | 20070523 |
EP-2465504-A1 | Novel 2,3-diamino-quinazolinone derivatives and their medical use | 20070523 |
US-2010160315-A1 | Novel 2, 3-diamino-quinazolinone derivatives and their medical use | 20070523 |
US-8178544-B2 | 2, 3-diamino-quinazolinone derivatives and their medical use | 20070523 |
WO-2008142140-A2 | Novel 2,3-diamino-quinazolinone derivatives and their medical use | 20070523 |
Complexity: | 225 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 212.152477885 |
Formal Charge: | 0 |
Heavy Atom Count: | 15 |
Hydrogen Bond Acceptor Count: | 3 |
Hydrogen Bond Donor Count: | 2 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 212.152477885 |
Rotatable Bond Count: | 1 |
Topological Polar Surface Area: | 52.6 |
Undefined Atom Stereocenter Count: | 1 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | -0.4 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Alcohols and Derivatives
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS