4-Fluoropyridine-2-carbonitrile - CAS 847225-56-3
Catalog: |
BB037280 |
Product Name: |
4-Fluoropyridine-2-carbonitrile |
CAS: |
847225-56-3 |
Synonyms: |
4-fluoro-2-pyridinecarbonitrile; 4-fluoropyridine-2-carbonitrile |
IUPAC Name: | 4-fluoropyridine-2-carbonitrile |
Description: | 4-Fluoropyridine-2-carbonitrile (CAS# 847225-56-3) is a useful research chemical. |
Molecular Weight: | 122.10 |
Molecular Formula: | C6H3FN2 |
Canonical SMILES: | C1=CN=C(C=C1F)C#N |
InChI: | InChI=1S/C6H3FN2/c7-5-1-2-9-6(3-5)4-8/h1-3H |
InChI Key: | NIKWVAPXRQHXHR-UHFFFAOYSA-N |
Boiling Point: | 221.3 °C at 760 mmHg |
Density: | 1.24 g/cm3 |
LogP: | 1.09238 |
GHS Hazard Statement: | H302 (97.5%): Harmful if swallowed [Warning Acute toxicity, oral] |
Precautionary Statement: | P261, P264, P270, P271, P280, P301+P312, P302+P352, P304+P340, P305+P351+P338, P310, P312, P321, P330, P332+P313, P362, P403+P233, P405, and P501 |
Signal Word: | Danger |
Publication Number | Title | Priority Date |
CN-112250622-A | Preparation method of 4-fluoropyridine-2-amine | 20200923 |
CN-112279809-A | Preparation method of 2-cyano-4-fluoropyridine | 20200923 |
US-2021139494-A1 | Heterocyclic rip1 inhibitory compounds | 20191107 |
WO-2021092336-A1 | Heterocyclic rip1 inhibitory compounds | 20191107 |
US-2021070735-A1 | Rip1 inhibitory compounds and methods for making and using the same | 20190906 |
Complexity: | 137 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 122.02802627 |
Formal Charge: | 0 |
Heavy Atom Count: | 9 |
Hydrogen Bond Acceptor Count: | 3 |
Hydrogen Bond Donor Count: | 0 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 122.02802627 |
Rotatable Bond Count: | 0 |
Topological Polar Surface Area: | 36.7 Å2 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 1 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Nitrogen Compounds
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS