4-Fluoroisatin - CAS 346-34-9
Catalog: |
BB022213 |
Product Name: |
4-Fluoroisatin |
CAS: |
346-34-9 |
Synonyms: |
4-fluoro-1H-indole-2,3-dione; 4-fluoro-1H-indole-2,3-dione |
IUPAC Name: | 4-fluoro-1H-indole-2,3-dione |
Description: | 4-Fluoroisatin (CAS# 346-34-9) is a useful research chemical. |
Molecular Weight: | 165.12 |
Molecular Formula: | C8H4FNO2 |
Canonical SMILES: | C1=CC2=C(C(=C1)F)C(=O)C(=O)N2 |
InChI: | InChI=1S/C8H4FNO2/c9-4-2-1-3-5-6(4)7(11)8(12)10-5/h1-3H,(H,10,11,12) |
InChI Key: | VUPIFURSDLGPMH-UHFFFAOYSA-N |
Density: | 1.477 g/cm3 |
MDL: | MFCD01175824 |
LogP: | 1.09850 |
Publication Number | Title | Priority Date |
CN-111574426-A | Diamine monomer containing isoindigo structure and black polyimide synthesized from diamine monomer | 20200527 |
CN-110642773-A | Industrial preparation method of high-purity 4-fluoroisatin | 20180627 |
JP-2018150285-A | Method for producing isatin compound | 20170314 |
WO-2016202935-A1 | Glucose transport inhibitors | 20150619 |
WO-2016177340-A1 | Bicyclic substituted benzene sulfonamide derivative, and preparation method and pharmaceutical use thereof | 20150505 |
Complexity: | 241 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 165.02260653 |
Formal Charge: | 0 |
Heavy Atom Count: | 12 |
Hydrogen Bond Acceptor Count: | 3 |
Hydrogen Bond Donor Count: | 1 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 165.02260653 |
Rotatable Bond Count: | 0 |
Topological Polar Surface Area: | 46.2 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 0.8 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Indolines
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS