4-Fluoroindoline - CAS 552866-98-5
Catalog: |
BB028985 |
Product Name: |
4-Fluoroindoline |
CAS: |
552866-98-5 |
Synonyms: |
4-fluoro-2,3-dihydro-1H-indole; 4-fluoro-2,3-dihydro-1H-indole |
IUPAC Name: | 4-fluoro-2,3-dihydro-1H-indole |
Description: | 4-Fluoroindoline (CAS# 552866-98-5) is a useful research chemical. |
Molecular Weight: | 137.15 |
Molecular Formula: | C8H8FN |
Canonical SMILES: | C1CNC2=C1C(=CC=C2)F |
InChI: | InChI=1S/C8H8FN/c9-7-2-1-3-8-6(7)4-5-10-8/h1-3,10H,4-5H2 |
InChI Key: | CMQOXZRRFDMQKY-UHFFFAOYSA-N |
Boiling Point: | 215.7 °C at 760 mmHg |
Density: | 1.154 g/cm3 |
Appearance: | Solid |
LogP: | 1.93170 |
Publication Number | Title | Priority Date |
CN-113149847-A | Preparation method of aryl tertiary amine compound | 20210422 |
CN-112321478-A | Synthetic method of 4-fluoro-7-nitroindole or derivative thereof | 20200909 |
WO-2021098737-A1 | Fused heterocyclic derivative and use thereof | 20191118 |
WO-2021093795-A1 | Rock inhibitor, preparation method therefor and use thereof | 20191115 |
WO-2021041976-A1 | Perk inhibiting indolinyl compounds | 20190829 |
Complexity: | 126 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 137.064077422 |
Formal Charge: | 0 |
Heavy Atom Count: | 10 |
Hydrogen Bond Acceptor Count: | 2 |
Hydrogen Bond Donor Count: | 1 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 137.064077422 |
Rotatable Bond Count: | 0 |
Topological Polar Surface Area: | 12 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 2 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Indolines
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS