4-Fluoro-5-(2-fluorophenyl)-1H-pyrrole-3-carbaldehyde - CAS 928324-57-6
Catalog: |
BB040664 |
Product Name: |
4-Fluoro-5-(2-fluorophenyl)-1H-pyrrole-3-carbaldehyde |
CAS: |
928324-57-6 |
Synonyms: |
4-fluoro-5-(2-fluorophenyl)-1H-pyrrole-3-carboxaldehyde; 4-fluoro-5-(2-fluorophenyl)-1H-pyrrole-3-carbaldehyde |
IUPAC Name: | 4-fluoro-5-(2-fluorophenyl)-1H-pyrrole-3-carbaldehyde |
Description: | 4-Fluoro-5-(2-fluorophenyl)-1H-pyrrole-3-carbaldehyde (CAS# 928324-57-6) is an intermediate in the preparation of pyrroles as acid secretion inhibitors for treating ulcer and related disorders. |
Molecular Weight: | 207.18 |
Molecular Formula: | C11H7F2NO |
Canonical SMILES: | C1=CC=C(C(=C1)C2=C(C(=CN2)C=O)F)F |
InChI: | InChI=1S/C11H7F2NO/c12-9-4-2-1-3-8(9)11-10(13)7(6-15)5-14-11/h1-6,14H |
InChI Key: | PYHWXGYYGAHMMQ-UHFFFAOYSA-N |
LogP: | 2.77240 |
Publication Number | Title | Priority Date |
AU-2006285641-A1 | 1-heterocyclylsulfonyl, 2-aminomethyl, 5- (hetero-) aryl substituted 1-h-pyrrole derivatives as acid secretion inhibitors | 20050830 |
AU-2013200142-A1 | 1-Heterocyclylsulfonyl, 3-aminomethyl, 5-(hetero-)aryl substituted 1-H-pyrrole derivatives as acid secretion inhibitors | 20050830 |
AU-2013200142-B2 | 1-Heterocyclylsulfonyl, 3-aminomethyl, 5-(hetero-)aryl substituted 1-H-pyrrole derivatives as acid secretion inhibitors | 20050830 |
AU-2013200142-C1 | 1-Heterocyclylsulfonyl, 3-aminomethyl, 5-(hetero-)aryl substituted 1-H-pyrrole derivatives as acid secretion inhibitors | 20050830 |
AU-2015268744-A1 | 1-Heterocyclylsulfonyl, 3-aminomethyl, 5-(hetero-)aryl substituted 1-H-pyrrole derivatives as acid secretion inhibitors | 20050830 |
Complexity: | 237 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 207.04957017 |
Formal Charge: | 0 |
Heavy Atom Count: | 15 |
Hydrogen Bond Acceptor Count: | 3 |
Hydrogen Bond Donor Count: | 1 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 207.04957017 |
Rotatable Bond Count: | 2 |
Topological Polar Surface Area: | 32.9 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 2 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Carbonyl Compounds
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS