4-fluoro-2,3-methylenedioxyphenylboronic acid - CAS 1256345-92-2
Catalog: |
BB006153 |
Product Name: |
4-fluoro-2,3-methylenedioxyphenylboronic acid |
CAS: |
1256345-92-2 |
Synonyms: |
(7-fluoro-1,3-benzodioxol-4-yl)boronic acid; (7-fluoro-1,3-benzodioxol-4-yl)boronic acid |
IUPAC Name: | (7-fluoro-1,3-benzodioxol-4-yl)boronic acid |
Description: | 4-fluoro-2,3-methylenedioxyphenylboronic acid (CAS# 1256345-92-2) is a useful research chemical. |
Molecular Weight: | 183.929 |
Molecular Formula: | C7H6BFO4 |
Canonical SMILES: | B(C1=C2C(=C(C=C1)F)OCO2)(O)O |
InChI: | InChI=1S/C7H6BFO4/c9-5-2-1-4(8(10)11)6-7(5)13-3-12-6/h1-2,10-11H,3H2 |
InChI Key: | MZBRLFXVMFAXIT-UHFFFAOYSA-N |
LogP: | -0.76580 |
Publication Number | Title | Priority Date |
US-2020165249-A1 | Functionalized heterocycles as antiviral agents | 20181121 |
KR-20210093951-A | Functionalized Heterocycles as Antiviral Agents | 20181121 |
EP-3262047-A1 | Imidazopyrimidine and imidazotriazine derivative, and pharmaceutical composition comprising the same | 20150226 |
JP-2018506561-A | Imidazopyrimidine and imidazotriazine derivatives, and pharmaceutical compositions containing the same | 20150226 |
JP-6692367-B2 | Imidazopyrimidine and imidazotriazine derivatives, and pharmaceutical compositions containing the same | 20150226 |
Complexity: | 191 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 184.034317 |
Formal Charge: | 0 |
Heavy Atom Count: | 13 |
Hydrogen Bond Acceptor Count: | 5 |
Hydrogen Bond Donor Count: | 2 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 184.034317 |
Rotatable Bond Count: | 1 |
Topological Polar Surface Area: | 58.9 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Other Building Blocks
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS